
CAS Number14861-17-7
SynonymsEINECS 238-932-7; 2,4-Dichlorophenyl p-aminophenyl ether; p-amino-2',4'-dichlorodiphenyl ether; 2,4-Dichloro-4'-aminodiphenyl ether; Aminonitrofen; 4-amino-2',4'-dichlorodiphenyl ether; MFCD00459612; 2',4'-Dichloro-4-aminobiphenyl ether
Molecular FormulaC20H19Cl2NO3
Molecular Weight392.285
Purity98%
Density1.364 g/cm3
Boiling Point359.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14861-17-7 |
| Catalog No. | 2A-9001830 |
| Chinese Name | 4-(2,4-二氯苯氧基)苯胺 |
| Synonyms | EINECS 238-932-7; 2,4-Dichlorophenyl p-aminophenyl ether; p-amino-2',4'-dichlorodiphenyl ether; 2,4-Dichloro-4'-aminodiphenyl ether; Aminonitrofen; 4-amino-2',4'-dichlorodiphenyl ether; MFCD00459612; 2',4'-Dichloro-4-aminobiphenyl ether |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.285 |
| Purity | 98 |
| Density | 1.364 g/cm3 |
| Boiling Point | 359.8ºC at 760 mmHg |
| HTC | 2922299090 |
| MDL Number | MFCD01185421 |
| SMILES | Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C12H9Cl2NO/c13-8-1-6-12(11(14)7-8)16-10-4-2-9(15)3-5-10/h1-7H,15H2 |
| InChI Key | RWDOREOERSVIRK-UHFFFAOYSA-N |
| MSDS | msds/1830_1_14861_17_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-3,5-dinitrobenzotrifluoride | 29091-09-6 | 2A-9001825 |
| 2,4-Dichloro-3-ethyl-6-nitrophenol | 99817-36-4 | 2A-9001826 |
| 2,4-Dichloro-3-fluorobenzonitrile | 161612-68-6 | 2A-9001827 |
| 2,4-Dichloro-3-fluoronitrobenzene | 393-79-3 | 2A-9001828 |
| 2,4-Dichloro-3-nitro-5-methylbenzotrifluoride | 115571-69-2 | 2A-9001829 |
| 2,4-Dichloro-5-aminophenol | 39489-79-7 | 2A-9001833 |
| 2,4-Dichloro-5-aminosulfamylbenzoic acid | 2A-101834 | 2A-9001834 |
| 2,4-Dichloro-5-fluoro-3-hydroxybenzoic acid | 290835-84-6 | 2A-9001835 |
| 2,4-Dichloro-5-fluoro-3-nitrobenzoic acid | 106809-14-7 | 2A-9001837 |
| 2,4-Dichloro-5-fluoroaniline | 348-64-1 | 2A-9001839 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA