
CAS Number3284-79-5
Synonyms2-(4-chlorophenoxy)propionic acid; 3-(4-chloro-phenoxy)-propionic acid; 3-(p-Chlorophenoxy)propionic acid; EINECS 221-932-6; 3-(4-Chlor-phenoxy)-propionsaeure; MFCD00043504
Molecular FormulaClC6H4OCH2CH2CO2H
Molecular Weight200.62
Density1.311g/cm3
Boiling Point308.3ºC at 760mmHg
Melting Point136-140ºC(lit.)
EINECS221-932-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3284-79-5 |
| Catalog No. | 2A-3181861 |
| Chinese Name | 3-(4-氯苯氧基)丙酸 |
| Synonyms | 2-(4-chlorophenoxy)propionic acid; 3-(4-chloro-phenoxy)-propionic acid; 3-(p-Chlorophenoxy)propionic acid; EINECS 221-932-6; 3-(4-Chlor-phenoxy)-propionsaeure; MFCD00043504 |
| Molecular Formula | ClC6H4OCH2CH2CO2H |
| Molecular Weight | 200.62 |
| Density | 1.311g/cm3 |
| Boiling Point | 308.3ºC at 760mmHg |
| Melting Point | 136-140ºC(lit.) |
| Storage Condition | Room temperature, dry, sealed |
| EINECS | 221-932-6 |
| HTC | 2918990090 |
| PubChem ID | 24884149 |
| MDL Number | MFCD00043504 |
| SMILES | O=C(O)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO3/c10-7-1-3-8(4-2-7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChI Key | OWHJDUCBLVMRBJ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2'-Methyl-4'-nitroacetanilide | 2719-15-5 | 2A-3181856 |
| 4,4'-Bis(N,N-dimethylamino)biphenyl | 366-29-0 | 2A-3181857 |
| 7-Methyl-2H-chromen-2-one | 2445-83-2 | 2A-3181858 |
| 2-bromo-,(4-bromophenyl)methyl ester Acetic acid, | 2098539-44-5 | 2A-3181859 |
| 2-chloro-4-methylbenzenethiol | 5375-97-3 | 2A-3181860 |
| 2,4,6-trihydroxy acetophenone | 249278-28-2 | 2A-3181862 |
| 4-benzyloxy 3-methoxy benzyl alcohol | 33693-48-0 | 2A-3181864 |
| 2-tert-butyl-4,5-xylenol | 1445-23-4 | 2A-1181865 |
| 4-tert-butyl-2,5-xylenol | 17696-37-6 | 2A-1181866 |
| 2,2'-(2-methylpropylidene)bis[4,6-xylenol] | 33145-10-7 | 2A-1181867 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA