
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 126771-41-3 |
| Catalog No. | 2A-3181818 |
| Chinese Name | 4-(溴甲基)苯氧基乙酸 |
| Synonyms | MFCD02258488 |
| Molecular Formula | C9H13BrClNO |
| Molecular Weight | 266.567 |
| Density | 1.59 g/cm3 |
| Boiling Point | 363ºC at 760 mmHg |
| Melting Point | 138-142ºC |
| Appearance | White or light brown powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 43608059 |
| MDL Number | MFCD01895801 |
| SMILES | O=C(O)COc1ccc(CBr)cc1 |
| InChI | InChI=1S/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChI Key | COFFWUSSQYARLB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-hydroxy phenoxy aceticacid | 1878-84-8 | 2A-3181811 |
| 4-benzyl phenol | 101-53-1 | 2A-3181813 |
| methyl-2,6-dichloro benzoate | 14920-87-7 | 2A-3181814 |
| 4-(2-pyridyl azo) resorcinol | 1141-59-9 | 2A-3181816 |
| 3',4'-dimethoxy flavone | 2A-3181817 | 2A-3181817 |
| 7-hydroxy chromone | 59887-89-7 | 2A-3181819 |
| 2-azido aceticacid | 18523-48-3 | 2A-3181821 |
| 4-hydroxy-3-iodo acetophenone | 62615-24-1 | 2A-3181822 |
| 3-amino-4-bromo acetophenone | 37148-51-9 | 2A-3181823 |
| 6-acetyl-2-(3H)benzoxazolone | 54903-09-2 | 2A-3181824 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA