
CAS Number1116-50-3
Synonyms3-Aethoxy-4-brom-crotonsaeure-aethylester; Ethyl 3-ethoxy-4-bromo-2-butenoate; 4-Bromo-3-ethoxy-2-butenoic acid ethyl ester; 4-Brom-3-ethoxy-crotonsaeure-ethylester; MFCD00051757; ETHYL 4-BROMO-3-ETHOXYBUT-2-ENOATE; 3-ethoxy-4-bromo-crotonic acid ethyl ester
Molecular FormulaC12H21NO4
Molecular Weight243.305
Density1.339g/cm3
Boiling Point88ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1116-50-3 |
| Catalog No. | 2A-3181786 |
| Chinese Name | 4-溴-3-乙氧基-2-丁烯酸乙酯 |
| Synonyms | 3-Aethoxy-4-brom-crotonsaeure-aethylester; Ethyl 3-ethoxy-4-bromo-2-butenoate; 4-Bromo-3-ethoxy-2-butenoic acid ethyl ester; 4-Brom-3-ethoxy-crotonsaeure-ethylester; MFCD00051757; ETHYL 4-BROMO-3-ETHOXYBUT-2-ENOATE; 3-ethoxy-4-bromo-crotonic acid ethyl ester |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.305 |
| Density | 1.339g/cm3 |
| Boiling Point | 88ºC |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | III |
| HTC | 2918990090 |
| PubChem ID | 11605315 |
| MDL Number | MFCD18430755 |
| SMILES | CCOC(=O)C=C(CBr)OCC |
| InChI | InChI=1S/C8H13BrO3/c1-3-11-7(6-9)5-8(10)12-4-2/h5H,3-4,6H2,1-2H3/b7-5+ |
| InChI Key | FYYMWILFRUUBCX-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DIETHYL DIBROMOMALONATE | 631-22-1 | 2A-2181779 |
| 4-Bromobutyronitrile | 1253-67-4 | 2A-2181781 |
| 4,4'-dihydroxy azobenzene | 2050-16-0 | 2A-3181779 |
| galesto phenone(2,3,4-trihydroxy acetophenone) | 2A-3181784 | 2A-3181784 |
| 7-bromo-2H-1,4-benzothiazin-3(4H)-one | 90814-91-8 | 2A-3181785 |
| 5-hydroxy-4',6,7- trimethoxy flavone | 2A-3181788 | 2A-3181788 |
| 6,3'-dihydroxy flavone | 2A-3181789 | 2A-3181789 |
| Aramid fibers | 308069-56-9 | 2A-2181792 |
| POLYETHERIMIDE | 61128-46-9 | 2A-2181795 |
| FLUOROLUBE GREASE, GR-362 | 9002-83-9 | 2A-2181796 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA