
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 49640-66-6 |
| Catalog No. | 2A-1181717 |
| Chinese Name | 1-(羟甲基)环丙烷羧酸 |
| Synonyms | MFCD17078844 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918199090 |
| PubChem ID | 16946367 |
| SMILES | O=C(O)C1(CO)CC1 |
| InChI | InChI=1S/C5H8O3/c6-3-5(1-2-5)4(7)8/h6H,1-3H2,(H,7,8) |
| InChI Key | TYFMINBPAYVYCW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-[(3-Pyridinyl)phenyl]boronic acid | 351422-72-5 | 2A-3181695 |
| Dibenzofuran-4-Boronic acid pinacol ester | 2A-3181696 | 2A-3181696 |
| thianthren-2-yl boronic acid | 108847-21-8 | 2A-3181703 |
| thianthren-2-yl boronic acid | 1048990-21-1 | 2A-3181709 |
| 3-Fluoro-4'-Methyl[1,1']biphenyl-4-yl-boronic acid | 1698890-39-9 | 2A-3181715 |
| 4-chloro-2-(Methoxycarbonyl)phenylboronic acid | 1612256-37-7 | 2A-3181716 |
| 4-hydroxy azo benzene-4-carboxylate monohydrate | 2497-38-3 | 2A-3181782 |
| 2-furoic hydrazide | 3326-71-4 | 2A-3181805 |
| 3,4-bis(2-Methoxyethoxy)benzaldehyde | 80407-64-3 | 2A-2181878 |
| 4-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzonitrile | 863866-22-8 | 2A-3181873 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA