
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25162-00-9 |
| Catalog No. | 2A-1181649 |
| Chinese Name | (+)-尼古丁 |
| Synonyms | leukotriene B4 ethanol solution; R-(+)-Nicotine; Leukotriene B4; 6Z,8E,10E,14Z,5S,12R-diHETE; LTB4 |
| Molecular Formula | C9H13O2N2Cl1 |
| Molecular Weight | 216.67 |
| Purity | 98.00 |
| Density | 1.032g/cm3 |
| Boiling Point | 244.4ºC at 760mmHg |
| Storage Condition | -20°C |
| HTC | 2933990090 |
| PubChem ID | 587897 |
| MDL Number | MFCD28405345 |
| SMILES | CN1CCCC1c1cccnc1 |
| InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m1/s1 |
| InChI Key | SNICXCGAKADSCV-SNVBAGLBSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Alkaloids | ||
|---|---|---|
| Betaxolol Impurity | 131564-70-0 | 2A-3180447 |
| rac-Nicotine-1’-oxide | 23113-16-8 | 2A-1181645 |
| (1'S,2'S)-NICOTINE 1'-OXIDE | 51095-86-4 | 2A-1181646 |
| (1’S,2'S)-Nicotine 1'-Oxide and (1’R,2'S)-Nicotine 1'-Oxide Mixture | 2A-1181647 | 2A-1181647 |
| Nicotine N-β-D-Glucuronide | 153536-53-9 | 2A-1181648 |
| 3-Ethoxy Carbonyl Quinolizidine | 2A-3183127 | 2A-3183127 |
| 3-Ethoxycarbonyl quinolizidine | 2A-3183128 | 2A-3183128 |
| 7,10-Bis-O-(2,2,2-trichloroethoxycarbonyl)-10-deacetylbaccatin III | 95603-44-4 | 2A-3183162 |
| QUINIDINE SULFATE | 50-54-4 | 2A-3183319 |
| Glaucine HBr | 5996-06-5 | 2A-1184001 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA