
CAS Number6505-45-9
Synonyms1H-Indole-3-acetic acid, sodium salt (1:1); Sodium 1H-indol-3-ylacetate; Indole-3-acetic acid sodium salt; EINECS 201-748-2; MFCD00005636
Molecular FormulaC10H8NNaO2
Molecular Weight197.17
Purity98%%
Melting Point165-169ºC(lit.)
Appearancecrystalline | off-white to tan
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6505-45-9 |
| Catalog No. | 2A-4181636 |
| Chinese Name | IAA-Na 3-吲哚乙酸钠 |
| Synonyms | 1H-Indole-3-acetic acid, sodium salt (1:1); Sodium 1H-indol-3-ylacetate; Indole-3-acetic acid sodium salt; EINECS 201-748-2; MFCD00005636 |
| Molecular Formula | C10H8NNaO2 |
| Molecular Weight | 197.17 |
| Purity | 98% |
| Melting Point | 165-169ºC(lit.) |
| Appearance | crystalline | off-white to tan |
| Water Solubility | H2O: soluble |
| Storage Condition | −20°C |
| HTC | 2915291000 |
| PubChem ID | 24895985 |
| MDL Number | MFCD09039281 |
| SMILES | O=C([O-])Cc1c[nH]c2ccccc12.[Na+] |
| InChI | InChI=1S/C10H9NO2.Na/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5H2,(H,12,13);/q;+1/p-1 |
| InChI Key | YGSPWCVTJRFZEL-UHFFFAOYSA-M |
| NACRES Code | NA.52 |
| UNSPSC | 12352106 |
| Transport Info | Product name: 3-Indoleacetic acid sodium salt |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 4-Chloro-benzenesulfonic acid 5-(2,4-difluoro-phenyl)-5-[1,2,4]triazol-1-ylMethyl-tetrahydro-furan-3-ylMethyl ester | 175712-02-4 | 2A-3180834 |
| 2,4-DIMETHYLPENTANOIC ACID | 5868-33-7 | 2A-2181436 |
| 2,4-DIMETHYL-1-PENTANOL | 6305-71-1 | 2A-2181437 |
| 1-BroMo-2,4-diMethylpentane | 6570-91-8 | 2A-2181438 |
| 2,4-DIFLUORO-PYRIDINE-3-CARBALDEHYDE | 1227564-60-4 | 2A-2181520 |
| 2,4-DIISOPROPYLPHENOL | 2934-05-6 | 2A-2181718 |
| 5,5-dimethyl-1,3-bis(oxiranylmethyl)imidazolidine-2,4-dione | 15336-81-9 | 2A-2181790 |
| 2,4-dichloro-6-iodo aniline | 697-90-5 | 2A-3181800 |
| 2,4-DIETHOXYPYRIMIDINE | 20461-60-3 | 2A-1181826 |
| 2,4-di hydroxy-5-nitro acetophenone | 3328-77-6 | 2A-3181855 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA