
CAS Number2595-97-3
SynonymsD-(+)-Allose; aldehydo-D-allo-hexose; dl-Allose; β-D-Allose; EINECS 219-994-4; b-D-Allopyranose; Allose; TALOSE,D; aldehydo-D-allose; MFCD00135833; D-allose; D-Allopyranose; Allopyranose
Molecular FormulaC6H12O6
Molecular Weight180.16
Purity98%
Density1.6±0.1 g/cm3
Boiling Point527.1±50.0 °C at 760 mmHg
Melting Point148-150ºC(lit.)
Appearancewhite powder
EINECS219-994-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2595-97-3 |
| Catalog No. | 2A-4181560 |
| Chinese Name | D-阿洛糖 |
| Synonyms | D-(+)-Allose; aldehydo-D-allo-hexose; dl-Allose; β-D-Allose; EINECS 219-994-4; b-D-Allopyranose; Allose; TALOSE,D; aldehydo-D-allose; MFCD00135833; D-allose; D-Allopyranose; Allopyranose |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 527.1±50.0 °C at 760 mmHg |
| Melting Point | 148-150ºC(lit.) |
| Appearance | white powder |
| Storage Condition | Filled with argon gas and sealed in a cool and dry |
| EINECS | 219-994-4 |
| HTC | 2912491000 |
| PubChem ID | 24857188 |
| MDL Number | MFCD00063268 |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChI Key | InChIKey=WQZGKKKJIJFFOK-IVMDWMLBSA-N |
| Beilstein/REAXYS | 1724623 |
| NACRES Code | NA.22 |
| UNSPSC | 12352201 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| BETA-D-GLUCOSE (CONTAINS ALPHA-D-GLUCOSE) | 28905-12-6 | 2A-4181553 |
| Beta-D-Glucose | 31258-47-6 | 2A-4181554 |
| α-D-Mannopyranose | 7296-15-3 | 2A-4181555 |
| Alpha-D-Mannose | 27710-20-9 | 2A-4181556 |
| β-D-Mannopyranose | 7322-31-8 | 2A-4181557 |
| BETA-D-ALLOSE | 7283-09-2 | 2A-4181561 |
| α-D-Allopyranose | 7282-79-3 | 2A-4181562 |
| L-ALLOSE | 7635-11-2 | 2A-4181564 |
| 2-deoxy-erythro-pentose | 1724-14-7 | 2A-4181565 |
| 2-Deoxy-α-D-ribopyranose | 36792-85-5 | 2A-4181566 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA