
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43230-11-1 |
| Catalog No. | 2A-2181531 |
| Chinese Name | 1-(4-氨基-3-甲基苯基)-乙酮 |
| Synonyms | 6-Amino-3-acetyl-toluol; 1-(4-azanyl-3-methyl-phenyl)ethanone; 1-(4-amino-3-methyl-phenyl)-ethanone; 1-(4-Amino-3-methyl-phenyl)-aethanon |
| Molecular Formula | C9H11O1N1 |
| Molecular Weight | 149.19 |
| Density | 1.069 g/cm3 |
| Boiling Point | 310.9ºC at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 32694055 |
| MDL Number | MFCD11934358 |
| SMILES | CC(=O)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C9H11NO/c1-6-5-8(7(2)11)3-4-9(6)10/h3-5H,10H2,1-2H3 |
| InChI Key | NGOTZSLPEOKQGQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tin SulfideSelenide | 2A-3181517 | 2A-3181517 |
| Titanium Boride | 12045-63-5 | 2A-3181518 |
| Titanium Nitride | 25583-20-4 | 2A-3181519 |
| potassium trifluoro(2-(methylthio)pyrimidin-5-yl)borate | 1245906-73-3 | 2A-2181523 |
| 1-hexadecyl-3-methylimidazolium bromide | 132361-22-9 | 2A-2181529 |
| 4-acetyl-2-methylbenzoic acid | 55860-35-0 | 2A-2181532 |
| 2-DEOXY-2-FLUORO-D-GLUCOSE | 86783-82-6 | 2A-4181535 |
| MELIBIOSE | 585-99-9 | 2A-4181536 |
| Beta-D-Xylopyranose | 2460-44-8 | 2A-4181538 |
| alpha-D-Arabinopyranose (9CI) | 608-45-7 | 2A-4181541 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA