![N-(2-Aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]-2-thiophenecarboxamide hydrochloride structure, CAS 883976-12-3](/structures/210000/182254_1_883976_12_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 883976-12-3 |
| Catalog No. | 2A-2181332 |
| Chinese Name | M8 B hydrochloride |
| Synonyms | MFCD27978374; N-(2-Aminoethyl)-N-[4-(benzyloxy)-3-methoxybenzyl]-2-thiophenecarboxamide hydrochloride (1:1) |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 |
| Storage Condition | -20°C, sealed, dry |
| Application | M8-B is a potent transient receptor potential melastatin-8 (TRPM8) antagonist. M8-B blocks cold-induced and TRPM8 agonist-induced activation of TRPM8 channels. M8-B reduces deep body temperature (Tb) |
| PubChem ID | 224204499 |
| MDL Number | C22H25ClN2O3S |
| SMILES | COc1cc(CN(CCN)C(=O)c2cccs2)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C22H24N2O3S.ClH/c1-26-20-14-18(9-10-19(20)27-16-17-6-3-2-4-7-17)15-24(12-11-23)22(25)21-8-5-13-28-21;/h2-10,13-14H,11-12,15-16,23H2,1H3;1H |
| InChI Key | FMQJBHACRTZLME-UHFFFAOYSA-N |
| Transport Info | Product Name: M8 B hydrochloride |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-AZIDO-3-DEOXY-1,2:5,6-DI-O-ISOPROPYLIDENE-ALPHA-D-GLUCOFURANOSE | 13964-23-3 | 2A-4181271 |
| α-?D-?Gulofuranose, 1,?2:5,?6-?bis-?O-?(1-?methylethylidene)?-?, 3-?acetate | 26775-14-4 | 2A-4181272 |
| 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-gulofuranose | 19131-06-7 | 2A-4181273 |
| 3-O-Benzyl-1,2:5,6-di-O-isopropylidene -a-D-gulofuranose | 23885-38-3 | 2A-4181274 |
| 1,2-O-Isopropylidene-5-O-p-toluenesulfonyl-a-D-xylofuranose | 20513-95-5 | 2A-4181283 |
| 2-Thiophenecarboxamide, N-(2-aminoethyl)-N-[[3-methoxy-4-(phenylmethoxy)phenyl]methyl]- | 884049-35-8 | 2A-2181335 |
| 5-[(5-Nitro-2-thiazolyl)thio]-1,3,4thiadiazol-2-amine | 40045-50-9 | 2A-2181349 |
| 3-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-, ethyl ester | 27805-12-5 | 2A-2181372 |
| 1-(2-aminoethyl)-N,N-dimethyl-1H-pyrazole-4-sulfonamide | 1485698-36-9 | 2A-2181380 |
| 4-[(5-chloro-2-oxo-2H-benzothiazol-3-yl)acetyl]piperazine-1-ethanol monohydrochloride | 35941-71-0 | 2A-2181384 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA