
CAS Number5606-24-6
SynonymsEINECS 227-025-1; 2,6-Diamino-4-butylamino-s-triazine; 4,6-diamino-2-n-butylamino-1,3,5-triazine; 2-n-butylamino-4,6-diamino-1,3,5-triazine; N-Butylmelamine; N2-Butylmelamine; 2,4-Diamino-6-butylamino-1,3,5-triazine; 1,3,5-Triazine-2,4,6-triamine,N-butyl
Molecular FormulaC7H14N6
Molecular Weight182.23
Density1.277g/cm3
Boiling Point434ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5606-24-6 |
| Catalog No. | 2A-2180612 |
| Chinese Name | 2,4-二氨基-6-丁氨基-1,3,5-三嗪 |
| Synonyms | EINECS 227-025-1; 2,6-Diamino-4-butylamino-s-triazine; 4,6-diamino-2-n-butylamino-1,3,5-triazine; 2-n-butylamino-4,6-diamino-1,3,5-triazine; N-Butylmelamine; N2-Butylmelamine; 2,4-Diamino-6-butylamino-1,3,5-triazine; 1,3,5-Triazine-2,4,6-triamine,N-butyl |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 |
| Density | 1.277g/cm3 |
| Boiling Point | 434ºC at 760mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2933699090 |
| PubChem ID | 10262528 |
| SMILES | CCCCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H14N6/c1-2-3-4-10-7-12-5(8)11-6(9)13-7/h2-4H2,1H3,(H5,8,9,10,11,12,13) |
| InChI Key | CVKGSDYWCFQOKU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(4-TRIFLUOROMETHYLPHENYL)PYRIDINE | 203065-88-7 | 2A-2180595 |
| PYRIDINE-3-SULFONIC ACID SODIUM SALT | 15521-77-4 | 2A-2180597 |
| 4-MORPHOLINOPYRIDINE | 2767-91-1 | 2A-2180603 |
| [1,2,5]Thiadiazolo[3,4-c]pyridine, 4,7-dibroMo- | 333432-27-2 | 2A-2180604 |
| 2-ACETAMIDO-6-METHYLPYRIDINE | 5327-33-3 | 2A-2180607 |
| QUINOLINE SULPHATE | 54957-90-3 | 2A-2180615 |
| 5-AMINO-3-METHYL-1-P-TOLYLPYRAZOLE | 62535-60-8 | 2A-2180617 |
| 4-(PHENYLAMINO)PYRIDINE | 22961-45-1 | 2A-1180619 |
| 1-(2,6-diisopropylphenyl)-1H-imidazole | 25364-47-0 | 2A-2180620 |
| 3-METHYL-2(5H)-FURANONE | 22122-36-7 | 2A-2180621 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA