
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3378-82-3 |
| Catalog No. | 2A-2180584 |
| Chinese Name | 1-溴-2-萘甲醛 |
| Synonyms | EINECS 222-180-1; MFCD00046368; 1-bromonaphthalene-2-carbaldehyde |
| Molecular Formula | C11H7BrO |
| Molecular Weight | 235.08 |
| Density | 1.552g/cm3 |
| Boiling Point | 347.3ºC at 760mmHg |
| Melting Point | 118°C |
| Storage Condition | 2-8℃, avoid light, ventilated and dry place, seale |
| EINECS | 222-180-1 |
| HTC | 2913000090 |
| PubChem ID | 329768053 |
| MDL Number | MFCD00046368 |
| SMILES | O=Cc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C11H7BrO/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-7H |
| InChI Key | CYGUXEZVBLMVRV-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2613639 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,5-DIMETHOXY-4-METHYLBENZALDEHYDE | 4925-88-6 | 2A-1180279 |
| (2-Aminobenzo[d]oxazol-5-yl)-boronic acid hydrochloride | 1404480-15-4 | 2A-1180368 |
| 1,1,2,2,3,3,4,4,4-Nonafluoro-butane-1-sulfonic acid 2,2,2-trifluoro-1-trifluoromethyl-ethyl ester | 118334-96-6 | 2A-1180371 |
| 3-(BROMOMETHYL)PYRENE | 2595-90-6 | 2A-2180464 |
| d3-isomer Cefmenoxime impurity | 126747-52-2 | 2A-3180559 |
| 5-hydroxy-4-methoxy-2-nitro-benzaldehyde | 58749-47-6 | 2A-3180602 |
| N-Methyl-4-(4-(3-(trifluoroMethyl)benzaMido)phenoxy)picolinaMide Tosylate | 1338443-27-8 | 2A-1180662 |
| [1,1'-Biphenyl]-3-carboxylic acid, 5'-chloro-2'-hydroxy- | 376592-57-2 | 2A-1180700 |
| 3'-aMino-2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid hydrochloride | 376591-97-8 | 2A-1180701 |
| Cefpodoxime Proxetil 4,7-seco-Dimer | 947692-16-2 | 2A-3180700 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA