
CAS Number33863-86-4
SynonymsEINECS 251-703-6; MFCD00000689; 4-n-butyloxybenzoic acid chloride; 4-(n-butyloxy)bezoyl chloride; p-n-butoxybenzoylchloride; 4-Butoxy-benzoyl chloride; 4-n-butoxybenzoyl chloride; Benzoyl chloride,4-butoxy; 4-(n-butyloxy)benzoyl chloride
Molecular FormulaC11H13O2Cl1
Molecular Weight212.68
Density1.122 g/mL at 25 °C(lit.)
Boiling Point160 °C8 mm Hg(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33863-86-4 |
| Catalog No. | 2A-2180520 |
| Chinese Name | 4-丁氧基苯甲酰氯 |
| Synonyms | EINECS 251-703-6; MFCD00000689; 4-n-butyloxybenzoic acid chloride; 4-(n-butyloxy)bezoyl chloride; p-n-butoxybenzoylchloride; 4-Butoxy-benzoyl chloride; 4-n-butoxybenzoyl chloride; Benzoyl chloride,4-butoxy; 4-(n-butyloxy)benzoyl chloride |
| Molecular Formula | C11H13O2Cl1 |
| Molecular Weight | 212.68 |
| Density | 1.122 g/mL at 25 °C(lit.) |
| Boiling Point | 160 °C8 mm Hg(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2918990090 |
| PubChem ID | 7528100 |
| MDL Number | MFCD00000689 |
| SMILES | CCCCOc1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C11H13ClO2/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3 |
| InChI Key | KMGCTFHTBKBITO-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,4'-BIPHENYLDICARBONYL CHLORIDE | 2351-37-3 | 2A-2180512 |
| 1,3-dibroMo-2-iodobenzene | 19821-80-8 | 2A-2180514 |
| 1,3,5-BENZENETRICARBONITRILE | 10365-94-3 | 2A-2180515 |
| [(2,6-DiMethylphenyl)aMino](oxo)acetic Acid | 2903-48-2 | 2A-0201112 |
| MONOHEXYL PHTHALATE | 24539-57-9 | 2A-2180517 |
| N-(3-Hydroxypropyl)aniline | 31121-11-6 | 2A-2180521 |
| 2,3,6-TRICHLOROPHENOL | 933-75-5 | 2A-2180522 |
| 1-((2-ETHYLHEXYL)OXY)-4-METHOXYBENZENE | 146370-51-6 | 2A-2180525 |
| BENZOYL BROMIDE | 618-32-6 | 2A-2180526 |
| BENZOIC ACID 2-ETHYLHEXYL ESTER | 5444-75-7 | 2A-2180527 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA