![BENZO[A]FLUOREN-11-ONE structure, CAS 479-79-8](/structures/210000/181356_1_479_79_8.png)
CAS Number479-79-8
Synonyms11-benzo[a]fluorenone; 11H-benzo<a>fluorene-11-one; 11H-benzo<a>fluorenone; 11H-Benzo[a]fluoren-11-one; Benzo[a]fluorenone
Molecular FormulaC17H10O
Molecular Weight230.27
Density1.3±0.1 g/cm3
Boiling Point431.7±12.0 °C at 760 mmHg
Melting Point134.0 to 138.0 °C
AppearanceYellow-dark yellow-red crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 479-79-8 |
| Catalog No. | 2A-2180500 |
| Chinese Name | 11H-苯并[a]芴-11-酮 |
| Synonyms | 11-benzo[a]fluorenone; 11H-benzo<a>fluorene-11-one; 11H-benzo<a>fluorenone; 11H-Benzo[a]fluoren-11-one; Benzo[a]fluorenone |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 431.7±12.0 °C at 760 mmHg |
| Melting Point | 134.0 to 138.0 °C |
| Appearance | Yellow-dark yellow-red crystal-powder |
| Storage Condition | 2-8°C |
| PubChem ID | 3147810 |
| MDL Number | MFCD00215960 |
| SMILES | O=C1c2ccccc2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C17H10O/c18-17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)17/h1-10H |
| InChI Key | RNICURKFVSAHLQ-UHFFFAOYSA-N |
| Transport Info | Product name: 11H-benzo[a]fluoren-11-one |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 11H-BENZO[B]FLUOREN-11-ONE | 3074-03-1 | 2A-2180490 |
| 4-N-HEPTYLBENZOYL CHLORIDE | 50606-96-7 | 2A-2180494 |
| 3BETA-HYDROXY-DELTA5-CHOLENIC ACID | 255-17-4 | 2A-2180495 |
| 3BETA-HYDROXY-DELTA5-CHOLENIC ACID | 5255-17-4 | 2A-2180496 |
| 2-METHYL-1-PHENYLPROPENE | 768-49-0 | 2A-2180497 |
| DIPHENYLAMINE SULFATE | 587-84-8 | 2A-2180501 |
| ARALDITE M | 3101-60-8 | 2A-2180502 |
| N,N-DIPHENYLFORMAMIDE | 607-00-1 | 2A-2180505 |
| N/A | 3184-71-2 | 2A-1180506 |
| BENZYL GLYCOLATE | 30379-58-9 | 2A-1180507 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA