CAS Number4118-51-8
SynonymsIsopropyl hydroxy(phenyl)acetate; isopropyl 2-hydroxy-2-phenylacetate; MANDELIC ACID,ISOPROPYL ESTER; Benzeneacetic acid, α-hydroxy-, 1-methylethyl ester; VOY1&i-propyl mandelate; Isopropyl mandelate
Molecular FormulaC11H14O3
Molecular Weight194.23
Density1.1±0.1 g/cm3
Boiling Point291.8±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4118-51-8 |
| Catalog No. | 2A-3180361 |
| Chinese Name | 2-羟基-2-苯基乙酸异丙酯 |
| Synonyms | Isopropyl hydroxy(phenyl)acetate; isopropyl 2-hydroxy-2-phenylacetate; MANDELIC ACID,ISOPROPYL ESTER; Benzeneacetic acid, α-hydroxy-, 1-methylethyl ester; VOY1&i-propyl mandelate; Isopropyl mandelate |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 291.8±20.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918199090 |
| SMILES | CC(C)OC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-8(2)14-11(13)10(12)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3 |
| InChI Key | SCJJMBMUZTUIJU-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine | 153437-78-6 | 2A-3180338 |
| 4-methoxy-3-(3-morpholinopropoxy)-2-nitrobenzonitrile | 1006378-06-8 | 2A-3180341 |
| 2-aMino-4-Methoxy-5-(3-Morpholinopropoxy)benzaMide | 246512-44-7 | 2A-3180342 |
| 4-Methoxy-5-(3-Morpholinopropoxy)-2-nitrobenzaMide | 861453-16-9 | 2A-3180343 |
| N-[4-(difluoromethoxy)-2-nitrophenyl]acetamide | 97963-75-2 | 2A-3180349 |
| 9,9'-BIFLUORENYLIDENE | 746-47-4 | 2A-1180362 |
| Bosutinib Monohydrate | 918639-08-4 | 2A-1180363 |
| Rolapitant | 552292-08-7 | 2A-1180364 |
| Intermediate of Rolapitant | 205654-80-4 | 2A-1180366 |
| NA | 10575-78-7 | 2A-1180370 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS