
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 220438-80-2 |
| Catalog No. | 2A-3180307 |
| Chinese Name | (4-羧基-2-乙氧基-苯基)-乙酸 |
| Synonyms | 4-(Carboxymethyl)-2-ethoxybenzoic acid |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21000 |
| HTC | 2918990090 |
| PubChem ID | 56428743 |
| SMILES | CCOc1cc(CC(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C11H12O5/c1-2-16-9-5-7(6-10(12)13)3-4-8(9)11(14)15/h3-5H,2,6H2,1H3,(H,12,13)(H,14,15) |
| InChI Key | PRZWZRNYTRQDLH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| 3-O-Decladinosyl-6-O-Methylerythronolide A | 118058-74-5 | 2A-3179582 |
| 1-Azepan-1-yl-2-chloro-ethanone | 52227-33-5 | 2A-4180027 |
| L-Phenylalanine, L-leucyl-, methyl ester, monohydrochloride | 6461-07-0 | 2A-4180037 |
| (alphaS)-alpha-Aminobenzenebutanoyl-L-leucyl-L-phenylalanine methyl ester mono(trifluoroacetate) | 868539-99-5 | 2A-4180038 |
| 10-Formylfolic Acid | 134-05-4 | 2A-3180085 |
| (Z)-Cinepazide | 88197-50-6 | 2A-3180483 |
| Cinepazide N-Oxide | 1227926-25-1 | 2A-3180484 |
| L-Arginine, α-Methyl-4-(2-Methylpropyl)benzeneacetate | 57469-82-6 | 2A-4180625 |
| L(+) CHOLINE BITARTRATE | 2A-4180784 | 2A-4180784 |
| D-GLUCOSAMINE-OXIME HYDROCHLORIDE | 54947-34-1 | 2A-4180957 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA