![D-Glucitol, 1,5-dideoxy-1,5-epithio-1-C-[5-[(4-ethoxyphenyl)Methyl]-2-Methoxy-4-Methylphenyl]-, (1S)- structure, CAS 898537-18-3](/structures/210000/181016_2_898537_18_3.png)
CAS Number898537-18-3
SynonymsTS-071; Luseogliflozin; Lusefi; (1S)-1,5-Anhydro-1-[5-(4-ethoxybenzyl)-2-methoxy-4-methylphenyl]-1-thio-D-glucitol; UNII-C596HWF74Z; TS-71; TS 071
Molecular FormulaC23H30O6S
Molecular Weight434.546
Density1.3±0.1 g/cm3
Boiling Point624.5±55.0 °C at 760 mmHg
Melting Point155.0-157.0℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 898537-18-3 |
| Catalog No. | 2A-2180195 |
| Chinese Name | 鲁格列净 |
| Synonyms | TS-071; Luseogliflozin; Lusefi; (1S)-1,5-Anhydro-1-[5-(4-ethoxybenzyl)-2-methoxy-4-methylphenyl]-1-thio-D-glucitol; UNII-C596HWF74Z; TS-71; TS 071 |
| Molecular Formula | C23H30O6S |
| Molecular Weight | 434.546 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 624.5±55.0 °C at 760 mmHg |
| Melting Point | 155.0-157.0℃ |
| Application | Luseogliflozin (TS 071) is a potent, selective, orally active sodium-dependent glucose cotransporter (SGLT) 2 inhibitor with an IC50 of 2.26nM, which is approximately 1765 times more selective than SG |
| PubChem ID | 17487976 |
| SMILES | CCOc1ccc(Cc2cc(C3SC(CO)C(O)C(O)C3O)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C23H30O6S/c1-4-29-16-7-5-14(6-8-16)10-15-11-17(18(28-3)9-13(15)2)23-22(27)21(26)20(25)19(12-24)30-23/h5-9,11,19-27H,4,10,12H2,1-3H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChI Key | WHSOLWOTCHFFBK-ZQGJOIPISA-N |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[p-(Hydroxymethyl)phenyl]propionic acid | 88416-60-8 | 2A-3180187 |
| 2-[(4-Acetylphenyl)methyl]cyclopentan-1-one | 96824-28-1 | 2A-3180188 |
| Nateglinide Methyl Ester | 105746-47-2 | 2A-3180191 |
| D-Phenylalanyl Nateglinide | 944746-48-9 | 2A-3180192 |
| Nateglinide Ethyl Ester | 187728-85-4 | 2A-3180193 |
| ReMogliflozin etabonate | 442201-24-3 | 2A-2180196 |
| N-Cyano-N'-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]carbamimidic acid methyl ester | 138035-55-9 | 2A-3180200 |
| 2-cyano-1,3-bis(2-(((5-methyl-1H-imidazol-4-yl)methyl)thio)ethyl)guanidine | 55272-86-1 | 2A-3180201 |
| N-CYANO-N',N'-DIMETHYLGUANIDINE | 1609-06-9 | 2A-3180202 |
| Itopride N-Oxide | 141996-98-7 | 2A-3180205 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA