
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1355338-16-7 |
| Catalog No. | 2A-3179848 |
| Chinese Name | 2-(4-氨基-3-氟苯基)-1,1,1,3,3,3-六氟丙-2-醇 |
| Synonyms | MFCD26383530 |
| Molecular Formula | C9H6O1N1F7 |
| Molecular Weight | 277.13900 |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2922199090 |
| PubChem ID | 172085982 |
| MDL Number | MFCD26383530 |
| SMILES | Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H6F7NO/c10-5-3-4(1-2-6(5)17)7(18,8(11,12)13)9(14,15)16/h1-3,18H,17H2 |
| InChI Key | BRZMDESUDCYGTI-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| lithium phenyl-2,4,6-trimethylbenzoylphosphinate | 85073-19-4 | 2A-4179835 |
| 1-(4-methoxyphenyl)-2-methylpropan-2-amine | 56490-94-9 | 2A-3179838 |
| 1-(5-(benzyloxy)-2-hydroxy-3-nitrophenyl)ethanone | 861841-94-3 | 2A-3179840 |
| 1-(3,4-dihydro-6,7-dimethoxyisoquinolin-2(1h)-yl)prop-2-en-1-one | 245057-86-7 | 2A-3179843 |
| 4-MERCAPTOACETOPHENONE | 3814-20-8 | 2A-3179847 |
| 6-Bromo-2-methyl-3,4-dihydroisoquinolin-1(2H)-one | 724422-42-8 | 2A-3179849 |
| 3-(aMinoMethyl)-4,6-diMethyl-1,2-dihydropyridin-2-one hydrochloride | 1173081-96-3 | 2A-3179852 |
| Methyl 5-Methyl-2-(Methylsulfonyl)benzoate | 1368374-12-2 | 2A-3179853 |
| 6-(2-Trifluoromethoxyphenyl)-nicotinic acid | 197847-94-2 | 2A-3179854 |
| 4-(3-Pyridyl)-1-butanol | 60753-14-2 | 2A-3179855 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA