
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 182499-89-4 |
| Catalog No. | 2A-0202133 |
| Chinese Name | 2-氨基-4-溴-6-氟苯酚 |
| Synonyms | PC2775; 2-amino-6-fluoro-4-bromophenol; 2-Amino-4-bromo-6-flourophenol; 5-Bromo-3-fluoro-2-hydroxyaniline |
| Molecular Formula | C6H5BrFNO |
| Molecular Weight | 206.01 |
| Purity | 98% |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 3161518 |
| SMILES | Nc1cc(Br)cc(F)c1O |
| InChI | InChI=1S/C6H5BrFNO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H,9H2 |
| InChI Key | BXNQDUMAPNIZAG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-(2-Bromo-1-oxobutyl)-8-hydroxy-2(1H)-quinolinone | 59827-93-9 | 2A-4179828 |
| 3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE | 873056-62-3 | 2A-4179829 |
| 3-broMo-3-chloro-biphenyl | 844856-42-4 | 2A-4179830 |
| 10-Demethoxy Nicergoline | 57935-65-6 | 2A-1179369 |
| Asphalt | 8052-42-4 | 2A-1179831 |
| 7-METHYL-1,4-BENZOTHIAZIN-3-ONE | 30322-02-2 | 2A-4179834 |
| lithium phenyl-2,4,6-trimethylbenzoylphosphinate | 85073-19-4 | 2A-4179835 |
| 1-(4-methoxyphenyl)-2-methylpropan-2-amine | 56490-94-9 | 2A-3179838 |
| 1-(5-(benzyloxy)-2-hydroxy-3-nitrophenyl)ethanone | 861841-94-3 | 2A-3179840 |
| 1-(3,4-dihydro-6,7-dimethoxyisoquinolin-2(1h)-yl)prop-2-en-1-one | 245057-86-7 | 2A-3179843 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA