![5-[3-(dimethylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol structure, CAS 18029-54-4](/structures/210000/180577_2_18029_54_4.png)
CAS Number18029-54-4
Synonyms5-Hydroxy-5-(3-dimetylamino-propyl)-5H-dibenzo<a,d>cyclohepten; 5-Hydroxy-5-<3-dimethylamino-propyl>-dibenzo<a,e><1,3,5>cycloheptatrien; 5-[3-(dimethylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol; 5-(3-(Dimethylamino)propyl)-5H-dibenzo[a,d][7]annulen-5-ol; 5-Hydroxy-5-<3-dimethylamino-propyl>-5H-dibenzo<a,d>cyclohepten; 5-(3-Dimethylaminopropyl)dibenzo<a,e>cycloheptatrien-5-ol; 5-(3-N,N-dimethylaminopropyl)-5H-dibenzo[a,d]cyclohepten-5-ol
Molecular FormulaC20H23NO
Molecular Weight293.40
Density1.099g/cm3
Boiling Point443ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18029-54-4 |
| Catalog No. | 2A-2179784 |
| Chinese Name | 5-[3-(二甲基氨基)丙基]-5H-二苯并[A,D]环庚烯-5-醇 |
| Synonyms | 5-Hydroxy-5-(3-dimetylamino-propyl)-5H-dibenzo<a,d>cyclohepten; 5-Hydroxy-5-<3-dimethylamino-propyl>-dibenzo<a,e><1,3,5>cycloheptatrien; 5-[3-(dimethylamino)propyl]-5H-dibenzo[a,d]cyclohepten-5-ol; 5-(3-(Dimethylamino)propyl)-5H-dibenzo[a,d][7]annulen-5-ol; 5-Hydroxy-5-<3-dimethylamino-propyl>-5H-dibenzo<a,d>cyclohepten; 5-(3-Dimethylaminopropyl)dibenzo<a,e>cycloheptatrien-5-ol; 5-(3-N,N-dimethylaminopropyl)-5H-dibenzo[a,d]cyclohepten-5-ol |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.40 |
| Density | 1.099g/cm3 |
| Boiling Point | 443ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| PubChem ID | 6482493 |
| SMILES | CN(C)CCCC1(O)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C20H23NO/c1-21(2)15-7-14-20(22)18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)20/h3-6,8-13,22H,7,14-15H2,1-2H3 |
| InChI Key | VMLRQKQUOMJJAN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Luxabendazole | 90509-02-7 | 2A-1179779 |
| LEVAMISOLE PHOSPHATE | 32093-35-9 | 2A-1179780 |
| Levamisole | 49548-36-9 | 2A-1179781 |
| O-METHYLISOUREA SULFATE | 29427-58-5 | 2A-1179782 |
| Penoxsulam | 219714-96-2 | 2A-2179783 |
| 1-PROPOXY-2-PROPANOL | 1569-01-3 | 2A-2179785 |
| 1-ETHOXY-2-PROPYL ACETATE | 54839-24-6 | 2A-2179786 |
| dipropylene glycol ethyl ether | 15764-24-6 | 2A-2179788 |
| Di(propylene glycol) methyl ether acetate | 88917-22-0 | 2A-2179789 |
| ETHYLENE GLYCOL DI-N-BUTYL ETHER | 112-48-1 | 2A-2179790 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA