
CAS Number1713-85-5
Synonyms3-chloro-2-hydroxypropanoic acid; beto-chlorolactic acid; 3-Chlorolactate; 3-Chlorolactic acid; Chlorolactic Acid; |A-Chlorolactic acid; 3-Chloro-2-hydroxypropionic acid
Molecular FormulaC3H5ClO3
Molecular Weight124.52300
Density1.519g/cm3
Boiling Point259.5ºC at 760mmHg
Melting Point77 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1713-85-5 |
| Catalog No. | 2A-3179710 |
| Chinese Name | 氯乳酸 |
| Synonyms | 3-chloro-2-hydroxypropanoic acid; beto-chlorolactic acid; 3-Chlorolactate; 3-Chlorolactic acid; Chlorolactic Acid; |A-Chlorolactic acid; 3-Chloro-2-hydroxypropionic acid |
| Molecular Formula | C3H5ClO3 |
| Molecular Weight | 124.52300 |
| Density | 1.519g/cm3 |
| Boiling Point | 259.5ºC at 760mmHg |
| Melting Point | 77 °C (lit.) |
| Appearance | solid |
| Storage Condition | 2-8°C |
| Packaging | III |
| HTC | 2918199090 |
| PubChem ID | 4949365 |
| SMILES | O=C(O)C(O)CCl |
| InChI | InChI=1S/C3H5ClO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7) |
| InChI Key | OSLCJYYQMKPZHU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| OXITROPIUM BROMIDE | 320346-78-9 | 2A-2179696 |
| 2-(4-Nitrophenyl)acetamide | 6321-12-6 | 2A-3179699 |
| 2-Fluoro-6-bromobenzyl bromide | 1548-81-8 | 2A-3179704 |
| 2-Bromo-5-chloro-4-fluoro-benzoic acid methyl ester | 1502835-28-0 | 2A-3179706 |
| Ethanone, 1-(3-amino-4-hydroxyphenyl)- (9CI) | 54255-50-4 | 2A-3179709 |
| 3-Ethyl-4-(hydroxyMethyl)benzonitrile | 202522-03-0 | 2A-3179711 |
| 3-HYDRAZINYL-N,N-DIMETHYLBENZENAMINE | 940924-81-2 | 2A-3179712 |
| 3-Amino4,5-Dimethoxybenzoicacid | 861556-80-1 | 2A-3179713 |
| 3-METHOXYBENZYLMAGNESIUM CHLORIDE | 26905-40-8 | 2A-3179715 |
| Methyl 2-benzyloxy-4-bromobenzoate | 1228095-06-4 | 2A-3179718 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA