
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30286-75-0 |
| Catalog No. | 2A-2179695 |
| Chinese Name | 氧托溴铵 |
| Synonyms | Oxivent; Oxitropium; Oxitropium bromide; Ba-253-BR-L; Ventilat; oxytropium bromide; Bromure d'oxitropium |
| Molecular Formula | C19H26BrNO4 |
| Molecular Weight | 394.30 |
| Melting Point | 203-204° (dec) |
| Storage Condition | -20°C, sealed, dry |
| Application | Oxitropium bromide is a muscarinic receptor antagonist. It is an anticholinergic bronchodilator drug used to treat asthma and chronic obstructive pulmonary disease. |
| PubChem ID | 12013430 |
| SMILES | CC[N+]1(C)C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC12.[Br-] |
| InChI | InChI=1S/C19H26NO4.BrH/c1-3-20(2)15-9-13(10-16(20)18-17(15)24-18)23-19(22)14(11-21)12-7-5-4-6-8-12;/h4-8,13-18,21H,3,9-11H2,1-2H3;1H/q+1;/p-1 |
| InChI Key | LCELQERNWLBPSY-BLYVRSIPSA-M |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: Oxytropium bromide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-Cyano-4-oxo-4H-1-benzopyran-8-yl)-4-(4-phenylbutoxy)benzamide | 136450-11-8 | 2A-2179688 |
| BENZYL-DBU-CHLORIDE | 49663-94-7 | 2A-2179689 |
| N-Propylsulfuric diamide-sodium | 1642873-03-7 | 2A-2179691 |
| Ethyl (2Z)-chloro[(4-methoxyphenyl)hydrazono]ethanoate | 473927-63-8 | 2A-2179692 |
| Despropionyl Ramelteon Hydrochloride | 196597-80-5 | 2A-2179693 |
| OXITROPIUM BROMIDE | 320346-78-9 | 2A-2179696 |
| 2-(4-Nitrophenyl)acetamide | 6321-12-6 | 2A-3179699 |
| 2-Fluoro-6-bromobenzyl bromide | 1548-81-8 | 2A-3179704 |
| 2-Bromo-5-chloro-4-fluoro-benzoic acid methyl ester | 1502835-28-0 | 2A-3179706 |
| Ethanone, 1-(3-amino-4-hydroxyphenyl)- (9CI) | 54255-50-4 | 2A-3179709 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA