
CAS Number97-72-3
Synonyms1Y1&VOVY1&1; Isobutyric acid anhydride; MFCD00008913; 2-Methylpropanoic anhydride; 2-methylpropanoyl 2-methylpropanoate; Propanoic acid, 2-methyl-, anhydride; EINECS 202-603-6; Isobutyric anhydride
Molecular Formula(CH3)2CHCO2COCH(CH3)2
Molecular Weight158.19
Purity97%
Density1.0±0.1 g/cm3
Boiling Point182 °C (lit.)
Melting Point−56 °C (lit.)
Appearanceliquid
EINECS202-603-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97-72-3 |
| Catalog No. | 2A-9018026 |
| Chinese Name | 异丁酸酐 |
| Synonyms | 1Y1&VOVY1&1; Isobutyric acid anhydride; MFCD00008913; 2-Methylpropanoic anhydride; 2-methylpropanoyl 2-methylpropanoate; Propanoic acid, 2-methyl-, anhydride; EINECS 202-603-6; Isobutyric anhydride |
| Molecular Formula | (CH3)2CHCO2COCH(CH3)2 |
| Molecular Weight | 158.19 |
| Purity | 97 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 182 °C (lit.) |
| Melting Point | −56 °C (lit.) |
| Appearance | liquid |
| Water Solubility | decomposes |
| Storage Condition | Storage Precautions Store in a cool, dry and well- |
| Packaging | II |
| EINECS | 202-603-6 |
| HTC | 2915900090 |
| PubChem ID | 24854757 |
| MDL Number | MFCD00008913 |
| SMILES | CC(C)C(=O)OC(=O)C(C)C |
| InChI | 1S/C8H14O3/c1-5(2)7(9)11-8(10)6(3)4/h5-6H,1-4H3 |
| InChI Key | LSACYLWPPQLVSM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 386267 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/18026_1_97_72_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Di-o-tolylguanidine | 97-39-2 | 2A-9018010 |
| 2-Methylvaleric acid | 97-61-0 | 2A-9018019 |
| Ethyl lactate | 97-64-3 | 2A-9018022 |
| L(-)-Malic acid | 97-67-6 | 2A-9018024 |
| 2-Acetylaminopropionic acid | 97-69-8 | 2A-9018025 |
| Bis(dimethylthiocarbamyl) sulfide | 97-74-5 | 2A-9018027 |
| Butyl isobutyrate | 97-87-0 | 2A-9018031 |
| Ethylene dimethacrylate | 97-90-5 | 2A-9018033 |
| Triethylaluminum | 97-93-8 | 2A-9018034 |
| Phenyltrimethylammonium iodide | 98-04-4 | 2A-9018042 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA