
CAS Number756-12-7
SynonymsHeptafluoroisopropyl trifluoromethyl ketone; 1,1,1,3,4,4,4-heptafluoro-3-trifluoromethyl-butan-2-one; Difluormethylperfluorisopropylketon; trifiuoromethyl perfluoroisopropyl ketone; Trifluoromethyl-perfluorisopropyl-Keton; PC0985; Trifluormethyl-perfluorisopropyl-Keton; 1,1,1,3,4,4,4-Heptafluoro-3-(Trifluoromethyl)-2-Butanone
Molecular FormulaC5F10O
Molecular Weight266.03700
Purity98%%
Density1.633g/cm3
Boiling Point24ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 756-12-7 |
| Catalog No. | 2A-4179365 |
| Chinese Name | 1,1,1,3,4,4,4-七氟-3-(三氟甲基)-2-丁酮 |
| Synonyms | Heptafluoroisopropyl trifluoromethyl ketone; 1,1,1,3,4,4,4-heptafluoro-3-trifluoromethyl-butan-2-one; Difluormethylperfluorisopropylketon; trifiuoromethyl perfluoroisopropyl ketone; Trifluoromethyl-perfluorisopropyl-Keton; PC0985; Trifluormethyl-perfluorisopropyl-Keton; 1,1,1,3,4,4,4-Heptafluoro-3-(Trifluoromethyl)-2-Butanone |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.03700 |
| Purity | 98% |
| Density | 1.633g/cm3 |
| Boiling Point | 24ºC |
| Storage Condition | 2-8°C, dry |
| HTC | 2914700090 |
| PubChem ID | 42578974 |
| SMILES | O=C(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F10O/c6-2(4(10,11)12,5(13,14)15)1(16)3(7,8)9 |
| InChI Key | ABQIAHFCJGVSDJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| trans-trans-4,4'-iminodimethylenedi(cyclohexanecarboxylic acid) | 93940-19-3 | 2A-3179307 |
| TRIFLUOROMETHYL METHYL ETHER | 421-14-7 | 2A-4179315 |
| ((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxaMido)propanaMido)butyl)boronic acid | 1132709-15-9 | 2A-3179351 |
| N-methyl-1,4-dioxaspiro[4,5]nonane-8-amino hydrochloride | 1703755-78-5 | 2A-2179352 |
| 3-Benzyloxy-4-oxo-4H-pyran-2-carboxylic acid methyl ester | 1332855-89-6 | 2A-2179361 |
| (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-17-carboxylic acid | 37926-75-3 | 2A-3179387 |
| 7-AMINO-3-[(Z)-PROP-1-ENYL]-3-CEPHEM-4-CARBOXYLIC ACID | 106447-44-3 | 2A-3179538 |
| N-(Chloromethyl)Dimethylamine. Hcl | 2A-3179701 | 2A-3179701 |
| (2-CHLOROMETHYL)-5-HYDROXY-4H-PYRAN-4-ONE | 7559-81-1 | 2A-3179703 |
| 5-BROMO-2,3-DIFLUORO-BENZALDEHYDE | 633327-22-7 | 2A-0201989 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA