![Daclatasvir impurity 15/N-[(1S)-1-[[(2S)-2-[5-[4’-[2-[(2S)-1-Acetyl-2-pyrrolidinyl]-1H-imidazol-5-yl][1,1’-biphenyl]-4-yl]-1H-imidazol-2-yl]-1-pyrrolidinyl]carbonyl]-2-methylpropyl]-methyl ester carbamic acid structure, CAS 2226541-13-3](/structures/210000/180110_3_2226541_13_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2226541-13-3 |
| Catalog No. | 2A-3179355 |
| Chinese Name | Daclatasvir Impurity B |
| Molecular Formula | C35H41N7O4 |
| Molecular Weight | 623.74 |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Daclatasvir Impurity B is an impurity in daclatasvir. Daclatasvir is a potent inhibitor of the HCV NS5A protein. |
| SMILES | COC(=O)NC(C(=O)N1CCCC1c1ncc(-c2ccc(-c3ccc(-c4cnc(C5CCCN5C(C)=O)[nH]4)cc3)cc2)[nH]1)C(C)C |
| InChI Key | JYVHPJBIMHHKQX-RWSKJCERSA-N |
| Transport Info | Product name: N-[(1S)-1-[[(2S)-2-[5-[4'-[2-[(2S)-1-Acetyl-2-pyrrolidinyl]-1H-imidazol-5-yl][1,1'-biphenyl]-4-yl]-1H-imidazol-2-yl]-1-pyrrolidinyl]carbonyl]-2-methylpropyl]-, methyl ester carbamic acid |
| Related Products in Analytical Standards | ||
|---|---|---|
| Budesonide Impurity 5 | 3517-49-5 | 2A-3179303 |
| Tranexamic acid impurity 2/Tranexamic EP Impurity C HCl/4-(aminomethyl)cyclohex-1-ene-1-carboxylic Acid hydrochloride | 1803601-44-6 | 2A-3179308 |
| EzetiMibe Dehydoxy IMpurity | 204589-58-2 | 2A-3179336 |
| EzetiMibe IMpurity 1 | 190595-66-5 | 2A-3179337 |
| Ezetimibe Impurity | 1510820-22-0 | 2A-3179341 |
| Lenvatinib Impurity 5 | 1788901-86-9 | 2A-3179356 |
| Dasatinib impurity 1/ 6-[4-(2-Hydroxyethyl)-1-piperazinyl]-2-methyl-4(3H)-pyrimidinone | 1778848-73-9 | 2A-3179360 |
| Bendamustine Ether Impurity | 1228552-02-0 | 2A-3179377 |
| Dexamethasone acetate impurity E | 1524-94-3 | 2A-3179383 |
| Betamethasone Acetate EP Impurity C | 330157-05-6 | 2A-3179388 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA