
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1131-17-5 |
| Catalog No. | 2A-3179261 |
| Chinese Name | 5-氯-3-甲基-1-苯基-1H-吡唑 |
| Synonyms | 5-chloro-3-methyl-1-phenyl-1H-pyrazole; MFCD00067853; 5-Chlor-3-methyl-1-phenyl-1H-pyrazol |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 |
| Density | 1.2g/cm3 |
| Boiling Point | 114-115°C 4mm |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933199090 |
| MDL Number | MFCD00067853 |
| SMILES | Cc1cc(Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H9ClN2/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChI Key | ZZOWFLAMMWOSCG-UHFFFAOYSA-N |
| MSDS | msds/179995_1_1131_17_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| ethyl 7,8-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate | 185011-75-0 | 2A-3179242 |
| 2-Bromo-7-fluoro-4-methyl-1,3-benzothiazole | 1019108-45-2 | 2A-3179244 |
| 4-Ethylthiazole-5-carboxylic acid | 126889-07-4 | 2A-3179245 |
| 2-n-Propylthiophene | 1551-27-5 | 2A-3179247 |
| 2-chloro-3-thiophenecarboxaldehyde | 14345-98-3 | 2A-3179248 |
| 3-(2-aminoethyl)-1H-indole-5,7-diol | 31363-74-3 | 2A-3179266 |
| 5,7-DIMETHOXY INDOLE;5,7-dimethoxy-1H-Indole | 27508-85-6 | 2A-3179269 |
| 4-CHLORO-3-IODOQUINOLINE | 590371-90-7 | 2A-1179278 |
| 4-HYDROXY-2-OXO-2H-CHROMENE-3-CARBALDEHYDE | 51751-34-9 | 2A-1179285 |
| 3-Bromo-2,6-difluoropyridine | 80392-79-6 | 2A-2179288 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA