![1-(2'-chloro-[1,1'-biphenyl]-4-yl)ethanone structure, CAS 3808-89-7](/structures/180000/179635_1_3808_89_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3808-89-7 |
| Catalog No. | 2A-3178924 |
| Chinese Name | 1-(2'-chloro-biphenyl-4-yl)-ethanone |
| Synonyms | 2'-chloro 4-acetyl biphenyl; 2-Chlor-4'-acetyl-biphenyl; 4-Acetyl-2'-chlor-biphenyl; 4-Acetyl-2'-chlorobiphenyl |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 |
| HTC | 2914700090 |
| MDL Number | MFCD02729260 |
| SMILES | CC(=O)c1ccc(-c2ccccc2Cl)cc1 |
| InChI Key | KQNNNDZVEYLTHF-UHFFFAOYSA-N |
| MSDS | msds/179635_1_3808_89_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-cyclopropyl-2-methylbenzoic acid | 2A-3178918 | 2A-3178918 |
| 1,3-DIETHYNYLBENZENE | 1785-61-1 | 2A-3178919 |
| 4-phenyl-1,2-thiazinane 1,1-dioxide | 133778-13-9 | 2A-3178921 |
| 1,4-BIS(3-AMINOPHENYL)BUTADIYNE | 31661-59-3 | 2A-3178922 |
| Carbamic acid, [2-(4-nitrophenyl)ethyl]-, 1,1-dimethylethyl ester | 144226-16-4 | 2A-2178922 |
| N-phenylpiracetam | 7458-01-7 | 2A-2178924 |
| 2-Methyl-3-methoxyaniline hydrochloride | 857195-15-4 | 2A-2178925 |
| 1-Methyl-1H-1,2,4-triazol-3-amine | 49607-51-4 | 2A-3178926 |
| 1-(5-METHYL-1H-PYRROL-3-YL) ETHAN-1-ONE | 6115-72-6 | 2A-3178927 |
| 1,3,5[10]-ESTRATRIEN-3-OL-17-ONE SULFATE POTASSIUM SALT | 1240-04-6 | 2A-2178927 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA