Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26159-35-3 |
| Catalog No. | 2A-3178035 |
| Chinese Name | 萘普生杂质E |
| Synonyms | methyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate; (S)-Methyl 2-(6-Methoxynaphthalen-2-Yl)Propanoate |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| Purity | ≥98.0 (HPLC) |
| Boiling Point | 358.7±17.0 °C |
| Melting Point | 87 °C |
| Appearance | solid |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2918990090 |
| PubChem ID | 329769059 |
| MDL Number | MFCD12031841 |
| SMILES | C[C@H](C(OC)=O)C1=CC2=CC=C(OC)C=C2C=C1 |
| InChI | 1S/C15H16O3/c1-10(15(16)18-3)11-4-5-13-9-14(17-2)7-6-12(13)8-11/h4-10H,1-3H3/t10-/m0/s1 |
| InChI Key | ZFYFBPCRUQZGJE-JTQLQIEISA-N |
| Beilstein/REAXYS | 4352971 |
| NACRES Code | NA.24 |
| UNSPSC | 12352108 |
| MSDS | msds/178644_1_26159_35_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Analytical Standards | ||
|---|---|---|
| Mupirocin Impurity D | 116182-43-5 | 2A-3178028 |
| Mupirocin calcium EP impurity E sodium salt | 116182-44-6 | 2A-3178029 |
| Nadolol EP impurity F | 2116-22-5 | 2A-3178030 |
| Nadolol impurity G | 33841-03-1 | 2A-3178031 |
| Naproxen Sodium Impurity O | 156967-24-7 | 2A-3178034 |
| Nicorandil Impurity 4 Dinitrate (Crude) | 1798026-96-6 | 2A-3178045 |
| Nilutamide EP Impurity C | 65274-43-3 | 2A-3178046 |
| Nitazoxanide Impurity 1 | 402848-76-4 | 2A-3178048 |
| Norethindrone EP Impurity F | 96487-85-3 | 2A-3178051 |
| Olanzapine EP Impurity C | 719300-59-1 | 2A-3178057 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS