
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52079-10-4 |
| Catalog No. | 2A-3178033 |
| Chinese Name | 萘普生杂质A |
| Synonyms | (2S)-2-(6-hydroxynaphthalen-2-yl)propanoic acid |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23 |
| Boiling Point | 444.1ºC at 760mmHg |
| Melting Point | 182-183ºC |
| Appearance | white |
| Storage Condition | 2-8°C |
| HTC | 2918199090 |
| SMILES | CC(C(=O)O)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C12H10O3.CH4/c13-11-4-3-9-5-8(6-12(14)15)1-2-10(9)7-11;/h1-5,7,13H,6H2,(H,14,15);1H4 |
| InChI Key | XWJUDDGELKXYNO-QMMMGPOBSA-N |
| UNSPSC | 41116107 |
| MSDS | msds/178642_1_52079_10_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Metronidazole-OH | 4812-40-2 | 2A-3178008 |
| 4-Epi Minocycline | 3168-51-0 | 2A-3178010 |
| Mirabegron metabolite M5 | 1365244-63-8 | 2A-3178011 |
| 8-Hydroxy Mirtazapine | 102335-57-9 | 2A-3178015 |
| Mirtazapine N-Oxide | 155172-12-6 | 2A-3178016 |
| Nebivolol Benzylated impurity | 929706-85-4 | 2A-3178036 |
| Nebivolol Desfluoro impurity | 118457-16-2 | 2A-3178037 |
| 2-Hydroxy Nevirapine | 254889-31-1 | 2A-3178040 |
| 3-Hydroxy Nevirapine | 174532-82-2 | 2A-3178041 |
| 12-Hydroxy Nevirapine | 133627-24-4 | 2A-3178042 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA