
CAS Number94-28-0
SynonymsHexanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; Flexol 3GO; 1,2-Ethanediylbis(oxy-2,1-ethanediyl) bis(2-ethylhexanoate); Ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylhexanoate); EINECS 202-319-2; triethylene glycol di-2-ethylhexanoate; MFCD00072285; 2-ethyl-hexanoic acid; UNII:GE16EV367Q; Flexol plasticizer 3GO
Molecular FormulaC22H42O6
Molecular Weight402.57
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point463.5±25.0 °C at 760 mmHg
Melting Point−50 °C(lit.)
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94-28-0 |
| Catalog No. | 2A-9017847 |
| Chinese Name | 三乙二醇二异辛酸酯 |
| Synonyms | Hexanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; Flexol 3GO; 1,2-Ethanediylbis(oxy-2,1-ethanediyl) bis(2-ethylhexanoate); Ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylhexanoate); EINECS 202-319-2; triethylene glycol di-2-ethylhexanoate; MFCD00072285; 2-ethyl-hexanoic acid; UNII:GE16EV367Q; Flexol plasticizer 3GO |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 463.5±25.0 °C at 760 mmHg |
| Melting Point | −50 °C(lit.) |
| Appearance | colorless liquid |
| Water Solubility | Insoluble |
| Storage Condition | Store airtight in a cool, dry place. |
| HTC | 2918990090 |
| MDL Number | MFCD00072285 |
| SMILES | CCCCC(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CCCC |
| InChI | InChI=1S/C22H42O6/c1-5-9-11-19(7-3)21(23)27-17-15-25-13-14-26-16-18-28-22(24)20(8-4)12-10-6-2/h19-20H,5-18H2,1-4H3 |
| InChI Key | FRQDZJMEHSJOPU-UHFFFAOYSA-N |
| MSDS | msds/17847_1_94_28_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| 4-Bromo-1,8-naphthalic anhydride | 81-86-7 | 2A-9017361 |
| 4-Bromophthalic anhydride | 82-73-5 | 2A-9017375 |
| Hexahydrophthalic anhydride | 85-42-7 | 2A-9017444 |
| 4-Bromophthalic anhydride | 86-90-8 | 2A-9017496 |
| 3,3'-Dimethyl-4,4'-biphenylene diisocyanate | 91-97-4 | 2A-9017730 |
| 4,4'-Diphenylmethane diisocyanate | 101-68-8 | 2A-9018263 |
| 4,4'-Oxydianiline | 101-80-4 | 2A-9018268 |
| 1,4-Phenylene diisocyanate | 104-49-4 | 2A-9018390 |
| gamma-Nonanolactone | 104-61-0 | 2A-9018399 |
| Isobutyl acrylate | 106-63-8 | 2A-9018512 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA