
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 154093-72-8 |
| Catalog No. | 2A-3177776 |
| Chinese Name | 8-羟基-6-氟加替沙星 |
| Synonyms | 1-cyclopropyl-6,7-difluoro-8-hydroxy-4-oxoquinoline-3-carboxylic acid |
| Molecular Formula | C13H9O4N1F2 |
| Molecular Weight | 281.22 |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| MDL Number | MFCD25973506 |
| SMILES | O=C(O)c1cn(C2CC2)c2c(O)c(F)c(F)cc2c1=O |
| InChI Key | NTWOKQCCNHKEIU-UHFFFAOYSA-N |
| MSDS | msds/178376_1_154093_72_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Gabapentin Quaternary salt (Iodide) | 1228301-72-1 | 2A-3177767 |
| Galantamine-N-Oxide | 199014-26-1 | 2A-3177769 |
| O-Desmethyl galantamine | 60755-80-8 | 2A-3177771 |
| Ganciclovir divalinate | 130914-71-5 | 2A-3177773 |
| Gatifloxacin N methyl impurity | 114213-69-3 | 2A-3177774 |
| Hydrocortisone-21-propionate | 6677-98-1 | 2A-3177782 |
| Hydrocortisone 9beta,11beta-Epoxide | 10072-97-6 | 2A-3177783 |
| Imatinib (Piperazine)-N4-Oxide(CS-T-56606)((crude) | 571186-91-9 | 2A-3177789 |
| Itraconazole hydroxy n-butyltriazolone impurity | 89848-20-4 | 2A-3177801 |
| Itraconazole Methoxy Isopropyltriazolone Impurity | 89848-14-6 | 2A-3177802 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA