
CAS Number93-11-8
SynonymsEINECS 202-219-9; MFCD00004087; β-Naphthalenesulfonyl chloride; 2-naphthylsulfonyl chloride; naphthalene-2-sulfonyl chloride; Naphthalene-2-sulfonic acid chloride; 2-Naphthalenesulfonyl chloride
Molecular FormulaC10H7ClO2S
Molecular Weight226.68
Purity99%
Density1.4±0.1 g/cm3
Boiling Point147.7 °C/0.6 mmHg (lit.)
Melting Point74-76 °C (lit.)
Appearancesolid
EINECS202-219-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93-11-8 |
| Catalog No. | 2A-9017794 |
| Chinese Name | 2-萘磺酰氯 |
| Synonyms | EINECS 202-219-9; MFCD00004087; β-Naphthalenesulfonyl chloride; 2-naphthylsulfonyl chloride; naphthalene-2-sulfonyl chloride; Naphthalene-2-sulfonic acid chloride; 2-Naphthalenesulfonyl chloride |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.68 |
| Purity | 99 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 147.7 °C/0.6 mmHg (lit.) |
| Melting Point | 74-76 °C (lit.) |
| Appearance | solid |
| Water Solubility | insoluble |
| Storage Condition | This product should be kept sealed and dry. |
| Packaging | II |
| EINECS | 202-219-9 |
| HTC | 29049020 |
| PubChem ID | 24848104 |
| MDL Number | MFCD00004087 |
| SMILES | ClS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | 1S/C10H7ClO2S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChI Key | OPECTNGATDYLSS-UHFFFAOYSA-N |
| Beilstein/REAXYS | 641898 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/17794_1_93_11_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 3-(1-Piperidinyl)propiophenone hydrochloride | 73-63-2 | 2A-9017043 |
| (2S)-3-[4-(aminomethyl)phenyl]-2-[(tert-butoxycarbonyl)amino]propanoic acid | 137452-49-4 | 2A-9017179 |
| 1-Naphthalenesulfonyl chloride | 85-46-1 | 2A-9017447 |
| 1-Naphthyl isocyanate | 86-84-0 | 2A-9017493 |
| Quinoxaline | 91-19-0 | 2A-9017696 |
| 4-Chloro-3-nitrobenzenesulfonyl chloride | 97-08-5 | 2A-9018001 |
| 4-Methoxybenzenesulfonyl chloride | 98-68-0 | 2A-9018083 |
| 4-Nitrophenyl isocyanate | 100-28-7 | 2A-9018188 |
| (6R-trans)-7-amino-8-oxo-3-[[(1,2,5,6-tetrahydro-2-methyl-5,6-dioxo-1,2,4-triazin-3-yl)thio]methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 58909-56-1 | 2A-9018195 |
| Phenyl isothiocyanate | 103-72-0 | 2A-9018356 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA