
CAS Number92-93-3
Synonymspnb; EINECS 202-204-7; 4-Nitrobiphenyl; 4-nitrolbiphenyl; MFCD00007342; 1-nitro-4-phenylbenzene
Molecular FormulaC12H8INO2
Molecular Weight325.107
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point340.0±11.0 °C at 760 mmHg
Melting Point114 °C
AppearanceWhite to yellow needle-like crystalline solid with a sweet taste
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 92-93-3 |
| Catalog No. | 2A-9017782 |
| Chinese Name | 4-硝基联苯 |
| Synonyms | pnb; EINECS 202-204-7; 4-Nitrobiphenyl; 4-nitrolbiphenyl; MFCD00007342; 1-nitro-4-phenylbenzene |
| Molecular Formula | C12H8INO2 |
| Molecular Weight | 325.107 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 340.0±11.0 °C at 760 mmHg |
| Melting Point | 114 °C |
| Appearance | White to yellow needle-like crystalline solid with a sweet taste |
| Water Solubility | insoluble |
| Storage Condition | This product should be sealed and stored away from |
| Packaging | III |
| HTC | 2904209020 |
| MDL Number | MFCD00024698 |
| SMILES | O=[N+]([O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9NO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChI Key | BAJQRLZAPXASRD-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/17782_1_92_93_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | X. Toxic Chemicals Environmental Management Release Notice |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Hydroxy-4'-methoxy-2-naphthanilide | 92-79-5 | 2A-9017772 |
| Phenazine | 92-82-0 | 2A-9017773 |
| Thianthrene | 92-85-3 | 2A-9017776 |
| Benzidine | 92-87-5 | 2A-9017778 |
| 4-Acetylbiphenyl | 92-91-1 | 2A-9017780 |
| p-Terphenyl | 92-94-4 | 2A-9017783 |
| 6-Amino-2-naphthalenesulfonic acid | 93-00-5 | 2A-9017784 |
| 6-Hydroxynaphthalene-2-sulphonic acid | 93-01-6 | 2A-9017785 |
| 2-Methoxynaphthalene | 93-04-9 | 2A-9017788 |
| 2-Acetonaphthone | 93-08-3 | 2A-9017791 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA