
CAS Number467-62-9
SynonymsPararosaniline; EINECS 207-395-0; Pararosaniline Base; MFCD00036222; Parafuchsin; Parafuchsin,Paramagenta; Parafuchsin Paramagenta; tris(4-aminophenyl)methanol
Molecular FormulaC19H19N3O
Molecular Weight305.37
Density1.287 g/cm3
Boiling Point598.9ºC at 760 mmHg
Melting Point205 °C (dec.) (lit.)
Appearancecrystalline
EINECS207-395-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 467-62-9 |
| Catalog No. | 2A-2177183 |
| Chinese Name | 付玫瑰苯胺 |
| Synonyms | Pararosaniline; EINECS 207-395-0; Pararosaniline Base; MFCD00036222; Parafuchsin; Parafuchsin,Paramagenta; Parafuchsin Paramagenta; tris(4-aminophenyl)methanol |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.37 |
| Density | 1.287 g/cm3 |
| Boiling Point | 598.9ºC at 760 mmHg |
| Melting Point | 205 °C (dec.) (lit.) |
| Appearance | crystalline |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| EINECS | 207-395-0 |
| HTC | 29252900 |
| PubChem ID | 24898736 |
| MDL Number | MFCD00036222 |
| SMILES | Nc1ccc(cc1)C(O)(c2ccc(N)cc2)c3ccc(N)cc3 |
| InChI | 1S/C19H19N3O/c20-16-7-1-13(2-8-16)19(23,14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,23H,20-22H2 |
| InChI Key | KRVRUAYUNOQMOV-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2148632 |
| NACRES Code | NA.47 |
| UNSPSC | 12171500 |
| MSDS | msds/177749_1_467_62_9.pdf |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-chloro-3-methoxy-5-bromobenzoate | 697762-67-7 | 2A-1177148 |
| 3-amino-6-(aminomethyl)-1,2,4-triazin-5(4H)-hydrochloride salt | 93206-04-3 | 2A-1177150 |
| 3-(METHYLSULFONYL)PROPANOIC ACID | 645-83-0 | 2A-1177151 |
| alcaftadine intermediate | 2A-3177156 | 2A-3177156 |
| (3)-Allopregnanolone Sulfate Sodium Salt | 215996-42-2 | 2A-3177158 |
| FORMANILIDE | 103-70-8 | 2A-2177184 |
| Aniline sulfate | 542-16-5 | 2A-2177185 |
| DI-N-HEXYLAMINE | 143-16-8 | 2A-2177186 |
| L-BUTHIONINE-(S,R)-SULFOXIMINE | 83730-53-4 | 2A-2177187 |
| ETHYLENEDIAMINE MONOHYDRATE | 6780-13-8 | 2A-2177188 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA