
CAS Number621-65-8
Synonyms1,2,3-propanetriol,1,2-dinitrate; glycerol,1,2-dinitrate; 1,2-GDN; 1,2-glyceryl dinitrate; propylene glycol 1,2-dinitrate; 1,2-DINITROGLYCERIN; Glycerin 1,2-dinitrate; glycerol dinitrate; 1,2-DNG; glyceryl-1,2-dinitrate; 3-hydroxypropane-1,2-dinitrate
Molecular FormulaC3H6N2O7
Molecular Weight182.09
Appearanceliquid
EINECS200-835-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 621-65-8 |
| Catalog No. | 2A-3177126 |
| Chinese Name | 1,2-二硝酸甘油 |
| Synonyms | 1,2,3-propanetriol,1,2-dinitrate; glycerol,1,2-dinitrate; 1,2-GDN; 1,2-glyceryl dinitrate; propylene glycol 1,2-dinitrate; 1,2-DINITROGLYCERIN; Glycerin 1,2-dinitrate; glycerol dinitrate; 1,2-DNG; glyceryl-1,2-dinitrate; 3-hydroxypropane-1,2-dinitrate |
| Molecular Formula | C3H6N2O7 |
| Molecular Weight | 182.09 |
| Appearance | liquid |
| EINECS | 200-835-2 |
| HTC | 2920909090 |
| PubChem ID | 329798580 |
| MDL Number | MFCD00661060 |
| SMILES | OC[C@@H](O[N+]([O-])=O)CO[N+]([O-])=O |
| InChI | 1S/C3H6N2O7/c6-1-3(12-5(9)10)2-11-4(7)8/h3,6H,1-2H2 |
| InChI Key | GFVHBTOOPNJKLV-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/177681_1_621_65_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5F-ADB or 5F-MDMB-PINACA | 1715016-75-3 | 2A-4177120 |
| 2-fluoro Deschloroketamine (hydrochloride) | 111982-49-1 | 2A-4177121 |
| 2,3-DIMETHYL-1,3-BUTADIENE | 513-81-5 | 2A-0201471 |
| SHVO'S CATALYST | 104439-77-2 | 2A-1177124 |
| plantago ovata | 90082-86-3 | 2A-1177125 |
| 1,3-Dinitroglycerin | 623-87-0 | 2A-3177127 |
| 4-Hydroxy Aceclofenac | 229308-90-1 | 2A-3177133 |
| 3-BroMo-4,5-dihydro-isoxazol-5-carboxaMide | 1030613-69-4 | 2A-1177136 |
| 6,7-DIBROMOBENZO(1,4)DIOXAN | 25812-80-0 | 2A-1177147 |
| Methyl 2-chloro-3-methoxy-5-bromobenzoate | 697762-67-7 | 2A-1177148 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA