
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 170098-98-3 |
| Catalog No. | 2A-2176841 |
| Chinese Name | 1-溴-4-氟-2-甲基-5-硝基苯 |
| Synonyms | 5-Bromo-2-fluoro-4-methylnitrobenzene; 2-Bromo-5-fluoro-4-nitrotoluene; 1-bromo-4-fluoro-2-methyl-5-nitro-benzene; X8161 |
| Molecular Formula | C8H8O4N1S1F1 |
| Molecular Weight | 234.02300 |
| Boiling Point | 290.7°C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2904909090 |
| MDL Number | MFCD04037941 |
| SMILES | Fc1c(cc(c(c1)C)[S](=O)(=O)C)[N+](=O)[O-] |
| InChI | 1S/C8H8FNO4S/c1-5-3-6(9)7(10(11)12)4-8(5)15(2,13)14/h3-4H,1-2H3 |
| InChI Key | KHAYNDCHBKGURZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/177376_1_170098_98_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Benzyloxy)-6-fluoroaniline | 160564-65-8 | 2A-2176835 |
| 4-(TERT-BUTOXY)BENZOTRIFLUORIDE | 16222-44-9 | 2A-2176836 |
| 5-Chloro-2,3-difluorobenzonitrile | 1624261-31-9 | 2A-2176837 |
| 3-methoxy-4-nitrophenol | 16393-95-8 | 2A-2176838 |
| 4-BroMo-2,3,5,6-tetrafluoroanisole | 1682-04-8 | 2A-2176840 |
| 4-Chloro-2-Methoxybenzyl cyanide | 170737-92-5 | 2A-2176842 |
| SodiuM 3-chloro-4-Methylbenzoate | 1708942-15-7 | 2A-2176843 |
| sodiuM 2-fluoro-4-Methylbenzoate | 1708942-19-1 | 2A-2176844 |
| Benzenethiol, 2,6-difluoro- (9CI) | 172366-44-8 | 2A-2176845 |
| 2-CHLOROBENZOIC ACID, SODIUM SALT | 17264-74-3 | 2A-2176846 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA