
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 150560-58-0 |
| Catalog No. | 2A-2176823 |
| Chinese Name | 5-异丙基吲哚啉-2,3-二酮 |
| Synonyms | 5-Isopropyl-1H-indole-2,3-dione; 5-Isopropylindoline-2,3-dione; 5-isopropyl-indole-2,3-dione; 5-isopropylisatin |
| Molecular Formula | C11H11O2N1 |
| Molecular Weight | 189.21 |
| Density | 1.2g/cm3 |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2942000000 |
| MDL Number | MFCD02947184 |
| SMILES | CC(C)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C11H11NO2/c1-6(2)7-3-4-9-8(5-7)10(13)11(14)12-9/h3-6H,1-2H3,(H,12,13,14) |
| InChI Key | LFNQRSQKXQFHDB-UHFFFAOYSA-N |
| MSDS | msds/177358_1_150560_58_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Isoquinoline, 6-(1-methylethyl)- (9CI) | 79304-84-6 | 2A-1176787 |
| 5-METHYL-2-PHENYL-PYRIDINE | 27012-22-2 | 2A-1176790 |
| 1-(3,5-dimethylphenyl)-6-(1-methylethyl)isoquinoline | 1936437-58-9 | 2A-1176791 |
| 1-fluorodibenzo[b,d]furan | 182349-08-2 | 2A-1176794 |
| 5-methyl-2-(p-tolyl)pyridine | 85237-71-4 | 2A-1176797 |
| 6,7-Dihydroquinoline-5,8-dione | 1522380-62-6 | 2A-2176827 |
| 2,2-Dimethyl-1,3-dioxane-5-carboxylic Acid Methyl Ester | 155818-14-7 | 2A-2176831 |
| 2-(Acetoxymethyl)-4- methoxy-3,5- dimethylpyridine | 2A-3176880 | 2A-3176880 |
| 2,3,4,4a,9,9a-hexahydro-1H-Pyrido[3,4-b]indole | 179111-91-2 | 2A-1176923 |
| 3-BROMO-1H-PYRROLE-2-CARBOXYLIC ACID METHYL ESTER | 941714-57-4 | 2A-1176924 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA