
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80696-29-3 |
| Catalog No. | 2A-2176504 |
| Chinese Name | (S)-(+)-2-氨基-1-己醇 |
| Synonyms | MFCD02683226; (2S)-2-aminohexan-1-ol; (2S)-2-Amino-1-hexanol; (S)-(+)-2-Amino-1-hexanol |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.189 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 191.9±0.0 °C at 760 mmHg |
| Melting Point | 35-40ºC(lit.) |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| SMILES | CCCC[C@H]([NH3+])CO |
| InChI | InChI=1S/C6H15NO/c1-2-3-4-6(7)5-8/h6,8H,2-5,7H2,1H3/p+1/t6-/m0/s1 |
| InChI Key | InChIKey=DPEOTCPCYHSVTC-LURJTMIESA-O |
| MSDS | msds/177029_2_80696_29_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,4-BUTANEDITHIOL | 1191-80-8 | 2A-1176486 |
| Thiazolidine, hydrochloride (1:1) | 14446-47-0 | 2A-3176453 |
| FADROZOLE HYDROCHLORIDE | 102676-31-3 | 2A-1176496 |
| Cis-Aconitic Acid | 585-84-2 | 2A-3176502 |
| ethane-1,2-diyl dibenzenesulfonate | 116-50-7 | 2A-3176503 |
| BIS(DIETHYLAMINO)PHENYLPHOSPHINE 97 | 1636-14-2 | 2A-2176507 |
| Carbamic acid, [2-(methylthio)ethyl]-, 1,1-dimethylethyl ester (9CI) | 174360-08-8 | 2A-2176508 |
| TERT-BUTYL 4-BROMO-3-METHYLBENZOATE | 347174-28-1 | 2A-2176511 |
| Chasteberry extract | 2A-4176513 | 2A-4176513 |
| Zirconyl propionate | 84057-80-7 | 2A-2176514 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA