
CAS Number40437-08-9
Synonymsacetobromolaminaribiose; O2,O3,O4,O6-Tetraacetyl-D-glucose; hepta-acetyllaminaribiosyl bromide; 2,3,4,6-tetra-O-acetyl glucose; 2,3,4,6-tetra-O-acetyl-D-glucose
Molecular FormulaC14H20O10
Molecular Weight411.20
Purity≥95 (TLC)%
Melting Point88.5 °C ((191.3 °F ))
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40437-08-9 |
| Catalog No. | 2A-1176455 |
| Chinese Name | 2,3,4,6-四-O-乙酰基-Β-D-葡萄糖 |
| Synonyms | acetobromolaminaribiose; O2,O3,O4,O6-Tetraacetyl-D-glucose; hepta-acetyllaminaribiosyl bromide; 2,3,4,6-tetra-O-acetyl glucose; 2,3,4,6-tetra-O-acetyl-D-glucose |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 411.20 |
| Purity | ≥95 (TLC) |
| Melting Point | 88.5 °C ((191.3 °F )) |
| Appearance | powder |
| HTC | 2915900090 |
| PubChem ID | 24890582 |
| MDL Number | MFCD00063254 |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | 1S/C14H19BrO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChI Key | CYAYKKUWALRRPA-RGDJUOJXSA-N |
| Beilstein/REAXYS | 96669 |
| NACRES Code | NA.25 |
| UNSPSC | 12352201 |
| MSDS | msds/176977_1_40437_08_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-broMo-3-(hydroxyMethyl)phenoxy)benzonitrile | 906673-45-8 | 2A-2176438 |
| 1-(4-aMino-5-Methoxy-2-Methylphenyl)-N,N-diMethylpiperidin-4-aMine | 1089279-91-3 | 2A-2176451 |
| 4-[4-(4-Methyl-piperazin-1-yl)-piperidin-1-yl]-1-nitrobenzene | 959795-69-8 | 2A-2176452 |
| 1-O-Benzyloxycarbonyl-4-O,6-O-ethylidene-β-D-glucopyranose | 35901-25-8 | 2A-1176453 |
| 2,3-DI-O-ACETYL-4,6-O-ETHYLIDENE-SS-D-GLUCOPYRANOSE | 118139-63-2 | 2A-1176454 |
| 1,2,3-TRI-O-ACETYL-4,6-O-ETHYLIDENE-BETA-D-GLUCOPYRANOSE | 27994-30-5 | 2A-1176457 |
| N/A | 14977-28-5 | 2A-1176458 |
| Protected BiapeneM | 155835-09-9 | 2A-1176460 |
| 2-(4-((4- chlorophenyl)(phenyl)methyl)piperazin-1- yl)acetic acid | 113740-61-7 | 2A-3176451 |
| 10-bromo-5H-dibenzo[b,f]azepine-5- carbimidic acid | 59690-97-0 | 2A-3176482 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA