
CAS Number1070-03-7
Synonymsl'acide mono(2-ethylhexyl)phosphorique; 2-ETHYLHEXYL PHOSPHATE; 2-ETHYLHEXYL ACID PHOSPHATE; 2-ethylhexyl dihydrogen phosphate; 2-ethylhexylphosphoric acid; Phosphoric acid dihydrogen (2-ethylhexyl); phosphoric acid 2-ethyldiphenyl ester; mono-(2-ethylhexyl)phosphoric acid; mono(2-ethylhexyl) phosphate
Molecular FormulaC8H19O4P
Molecular Weight130.23
Density1.127g/cm3
Boiling Point>180 °C/1013 hPa (decomposes)
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1070-03-7 |
| Catalog No. | 2A-1176399 |
| Chinese Name | 磷酸-2-乙基己酯 |
| Synonyms | l'acide mono(2-ethylhexyl)phosphorique; 2-ETHYLHEXYL PHOSPHATE; 2-ETHYLHEXYL ACID PHOSPHATE; 2-ethylhexyl dihydrogen phosphate; 2-ethylhexylphosphoric acid; Phosphoric acid dihydrogen (2-ethylhexyl); phosphoric acid 2-ethyldiphenyl ester; mono-(2-ethylhexyl)phosphoric acid; mono(2-ethylhexyl) phosphate |
| Molecular Formula | C8H19O4P |
| Molecular Weight | 130.23 |
| Density | 1.127g/cm3 |
| Boiling Point | >180 °C/1013 hPa (decomposes) |
| Appearance | liquid |
| HTC | 2919900090 |
| MDL Number | MFCD00040424 |
| SMILES | [P](=O)(O)(O)O.OCC(CCCC)CC |
| InChI | 1S/C8H18O.H3O4P/c1-3-5-6-8(4-2)7-9;1-5(2,3)4/h8-9H,3-7H2,1-2H3;(H3,1,2,3,4) |
| InChI Key | FZQYZMODYSBPES-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352106 |
| MSDS | msds/176910_1_1070_03_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trimetazidine dihydrochloride N-oxide | 2A-3176366 | 2A-3176366 |
| 4-(5-(pyridin-4-yl)-4H-1,2,4-triazol-3- yl)picolinamide | 2A-3176377 | 2A-3176377 |
| 4-(5-(pyridin-4-yl)-4H-1,2,4-triazol-3- yl)picolinic acid | 2A-3176378 | 2A-3176378 |
| 1,2-bis(4-(2-((2,4- dimethylphenyl)thio)phenyl)piperazin-1- yl)ethanone | 2A-3176397 | 2A-3176397 |
| (5-(2-fluorophenyl)-1-(pyridin-3-ylsulfonyl)- 1H-pyrrol-3-yl)methanamine | 2A-3176398 | 2A-3176398 |
| N,N-di(1-Methyl heptyl) acetamide | 77934-47-5 | 2A-1176400 |
| 1-(5-(2-fluorophenyl)-1H-pyrrol-3-yl)-N- methylmethanamine | 2A-3176399 | 2A-3176399 |
| 1-(2-fluorophenyl)ethanone | 2A-3176407 | 2A-3176407 |
| 1-(2-fluorophenyl)-3,3-diisocyanopropan-1- one | 2A-3176411 | 2A-3176411 |
| 2-(4-(3-(ethylamino)-2- hydroxypropoxy)phenyl)acetamide | 2A-3176417 | 2A-3176417 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA