
CAS Number1210-34-0
SynonymsMFCD00003593; Dibenzo(b,f)cycloheptan-1-ol; dibenzosuber-5-ol; 10,11-dihydro-5Hdibenzo[a,d]cicloheptadien-5-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol,10,11-dihydro; 10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzosuberol; EINECS 214-911-8
Molecular FormulaC15H14O1
Molecular Weight210.28
Density1.163g/cm3
Boiling Point166-169 °C (1 mmHg)
Melting Point90-95 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1210-34-0 |
| Catalog No. | 2A-3176343 |
| Chinese Name | 5-羟基-10,11-二氢-5H-二苯并[a,d][7]环庚烯 |
| Synonyms | MFCD00003593; Dibenzo(b,f)cycloheptan-1-ol; dibenzosuber-5-ol; 10,11-dihydro-5Hdibenzo[a,d]cicloheptadien-5-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol,10,11-dihydro; 10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzosuberol; EINECS 214-911-8 |
| Molecular Formula | C15H14O1 |
| Molecular Weight | 210.28 |
| Density | 1.163g/cm3 |
| Boiling Point | 166-169 °C (1 mmHg) |
| Melting Point | 90-95 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906299090 |
| MDL Number | MFCD00003593 |
| SMILES | OC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
| InChI Key | POAVRNPUPPJLKZ-UHFFFAOYSA-N |
| MSDS | msds/176854_1_1210_34_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Analytical Standards | ||
|---|---|---|
| Amlodipine EP Impurity D HCl | 2A-1176332 | 2A-1176332 |
| Aceclofenac Impurity 2 | 139272-68-7 | 2A-3176336 |
| Apremilast Impurity 28 | 1802246-60-1 | 2A-3176339 |
| Amiodarone Impurity B | 96027-74-6 | 2A-3176341 |
| Atorvastatin Impurity F(EP) | 1105067-87-5 | 2A-3176342 |
| Aripiprazole Impurity 3 | 1359829-23-4 | 2A-3176344 |
| Atorvastatin Impurity 9 | 345891-62-5 | 2A-3176346 |
| Atorvastatin Impurity 10 | 442851-50-5 | 2A-3176348 |
| Ambroxol EP Impurity D HCl | 1384955-66-1 | 2A-3176350 |
| Ambroxol Impurity 7 | 15942-11-7 | 2A-3176352 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA