![(E)-2-methyl-5-((1S,2S,4R)-2-methyl-3- methylenebicyclo[2.2.1]heptan-2-yl)pent-2- en-1-ol structure, CAS 11031-45-1](https://www.2abiotech.com/storage/file/20260617/9c089ad555237ad12c339d3347d29fa3ef878cd7.png)
CAS Number11031-45-1
SynonymsL535 B 1A GTJ D3UY1&1Q D1 E1; Santalol; 2-Methyl-5-(6-methyl-5-methylidene-6-bicyclo[2.2.1]heptanyl)pent-2-en-1-ol; 2-Methyl-5-(2-methyl-3-methylenebicyclo[2.2.1]hept-2-yl)-2-penten-1-ol; EINECS 234-262-4
Molecular FormulaC15H24O
Molecular Weight220.35
Purity≥80 (sum of isomers)%
Density1.0±0.1 g/cm3
Boiling Point101-103 °C/0.1 mmHg (lit.)
Appearancecolorless liquid
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 11031-45-1 |
| Catalog No. | 2A-3176290 |
| Chinese Name | 檀香醇 |
| Synonyms | L535 B 1A GTJ D3UY1&1Q D1 E1; Santalol; 2-Methyl-5-(6-methyl-5-methylidene-6-bicyclo[2.2.1]heptanyl)pent-2-en-1-ol; 2-Methyl-5-(2-methyl-3-methylenebicyclo[2.2.1]hept-2-yl)-2-penten-1-ol; EINECS 234-262-4 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| Purity | ≥80 (sum of isomers) |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 101-103 °C/0.1 mmHg (lit.) |
| Appearance | colorless liquid |
| Storage Condition | 2-8°C |
| Application | Santalol is a mixture of alpha and beta isomers of santalol. Alpha-santalol is isolated from sandalwood oil. Alpha-santalol is a promising anticancer drug that may prevent oral, breast, prostate and s |
| MDL Number | MFCD23701616 |
| SMILES | OC\C(=C\CC[C@]1([C@@H]2C[C@@H](CC2)C1=C)C)\C |
| InChI | 1S/C15H24O/c1-11(10-16)5-4-8-15(3)12(2)13-6-7-14(15)9-13/h5,13-14,16H,2,4,6-10H2,1,3H3/b11-5+/t13-,14+,15-/m1/s1 |
| InChI Key | OJYKYCDSGQGTRJ-INLOORNJSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/176800_1_11031_45_1.pdf |
| Transport Info | Product name: Santalol |
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA