
CAS Number6642-30-4
Synonymsmethyl-N-methylcarbamate; O-Methyl-N-methylcarbamate; Methyl methylcarbamate; EINECS 229-661-5; N-methyl methyl carbomate; methyl-carbamic acid methyl ester; N-methyl methyl carbamate; Carbamic acid,methyl-,methyl ester
Molecular FormulaC3H7O2N1
Molecular Weight89.09
Density0.986g/cm3
Boiling Point167.1ºC at 760 mmHg
Melting Point173-176 °C
AppearanceColorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6642-30-4 |
| Catalog No. | 2A-2176181 |
| Chinese Name | 甲基氨基甲酸甲酯 |
| Synonyms | methyl-N-methylcarbamate; O-Methyl-N-methylcarbamate; Methyl methylcarbamate; EINECS 229-661-5; N-methyl methyl carbomate; methyl-carbamic acid methyl ester; N-methyl methyl carbamate; Carbamic acid,methyl-,methyl ester |
| Molecular Formula | C3H7O2N1 |
| Molecular Weight | 89.09 |
| Density | 0.986g/cm3 |
| Boiling Point | 167.1ºC at 760 mmHg |
| Melting Point | 173-176 °C |
| Appearance | Colorless to yellow liquid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2924199090 |
| MDL Number | MFCD00082210 |
| SMILES | CNC(=O)OC |
| InChI | InChI=1S/C3H7NO2/c1-4-3(5)6-2/h1-2H3,(H,4,5) |
| InChI Key | NYXHSRNBKJIQQG-UHFFFAOYSA-N |
| MSDS | msds/176682_1_6642_30_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ethyl 4-(3-oxoMorpholino) phenylcarbaMate | 1327778-39-1 | 2A-3176163 |
| N-[4-(Ethoxycarbonylamino)phenyl]carbamic acid ethyl ester | 5466-93-3 | 2A-3176169 |
| 4-{4-[4-(2-Cyano-vinyl)-2,6-dimethyl-phenylamino]-1-oxy-pyrimidin-2-ylamino}-benzamide | 1446690-23-8 | 2A-3176177 |
| Ropivacaine-cycle | 1945965-95-6 | 2A-3176179 |
| Ropivacaine-iPr-S | 265120-58-9 | 2A-3176181 |
| Propoxyphenyl ThiohoMosidenafil | 479073-88-6 | 2A-3176184 |
| 4-(3,4-DICHLOROPHENYL)-1,2,3,4-TETRAHYDRO-1-NAPHTHALENOL | 866018-46-4 | 2A-3176186 |
| Ropivacaine-ET-S | 98626-59-6 | 2A-3176188 |
| 1-(3-BROMOPHENYL)-2-METHYLPROPAN-1-ONE | 2415-93-2 | 2A-2176182 |
| 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE | 156547-62-5 | 2A-3176193 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA