
CAS Number13456-39-8
Synonyms2-Diethylaminoethyl 4-nitrobenzoate; 4-Nitro-benzoesaeure-<2-diaethylamino-aethylester>; 4-nitro-benzoic acid-(2-diethylamino-ethyl ester); 2-Diethylaminoethyl p-nitrobenzoat; 2-Diethylaminoethyl p-nitrobenzoate
Molecular FormulaC13H18N2O4
Molecular Weight274.07
Density1.163g/cm3
Boiling Point385.1ºC at 760mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13456-39-8 |
| Catalog No. | 2A-3175800 |
| Chinese Name | 2-diethylaminoethyl 4-nitrobenzoate |
| Synonyms | 2-Diethylaminoethyl 4-nitrobenzoate; 4-Nitro-benzoesaeure-<2-diaethylamino-aethylester>; 4-nitro-benzoic acid-(2-diethylamino-ethyl ester); 2-Diethylaminoethyl p-nitrobenzoat; 2-Diethylaminoethyl p-nitrobenzoate |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 274.07 |
| Density | 1.163g/cm3 |
| Boiling Point | 385.1ºC at 760mmHg |
| Appearance | solid |
| HTC | 2922199090 |
| PubChem ID | 329772844 |
| MDL Number | MFCD11505948 |
| SMILES | COC(=O)c1ccc(cc1CBr)[N+]([O-])=O |
| InChI | 1S/C9H8BrNO4/c1-15-9(12)8-3-2-7(11(13)14)4-6(8)5-10/h2-4H,5H2,1H3 |
| InChI Key | PGNKFDOPHHNVNF-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/176258_1_13456_39_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (Z)-2-isocyano-5-oxo-4-(pyridin-4-yl)hex-3- enamide | 2A-3175771 | 2A-3175771 |
| 4-imino-N,N,2-trimethyl-3,3-diphenylhexan- 1-amine | 2A-3175772 | 2A-3175772 |
| 6-(dimethylamino)-5-methyl-4,4- diphenylhexan-3-one | 2A-3175773 | 2A-3175773 |
| 2-(2-butyl-4-hydroxy-6-MethylpyriMidin-5-yl)-N,N-diMethylacetaMide | 1315478-13-7 | 2A-4175761 |
| ethyl N-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)Methyl)-N-pentanoyl-L-valinate | 1111177-30-0 | 2A-4175778 |
| CYCLO(-GLU-GLU) | 16691-00-2 | 2A-3175814 |
| n-Propyl Dioxepin | 4469-34-5 | 2A-3175817 |
| N-((4-(5-Methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)acetaMide | 198471-06-6 | 2A-3175822 |
| ethyl hydrogen sulphate | 540-82-9 | 2A-3175823 |
| ETHYL CHLOROSULFONATE | 625-01-4 | 2A-3175824 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA