
CAS Number88-85-7
SynonymsGebutox; DINOSEB; (RS)-2-sec-butyl-4,6-dinitrophenol; Butaphene; Basanite; Kiloseb; 2-s-butyl-4,6-dinitrophenol; 2-butan-2-yl-4,6-dinitrophenol; 2-sec-Butyl-4,6-dinitrophenol; Phenotan; 2-(1-methylpropyl)-4,6-dinitrophenol; Dibutox; EINECS 201-861-7; DNBP; Hivertox; 4,6-Dinitro-o-sec-butylphenol; rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol; 2,4-dinitro-6-sec-butyl phenol; MFCD00024246
Molecular FormulaC10H12N2O5
Molecular Weight240.21300
Purity98.00%
Density1.29
Boiling Point318.1ºC at 760 mmHg
Melting Point55.5°C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88-85-7 |
| Catalog No. | 2A-9017589 |
| Chinese Name | 地乐酚 |
| Synonyms | Gebutox; DINOSEB; (RS)-2-sec-butyl-4,6-dinitrophenol; Butaphene; Basanite; Kiloseb; 2-s-butyl-4,6-dinitrophenol; 2-butan-2-yl-4,6-dinitrophenol; 2-sec-Butyl-4,6-dinitrophenol; Phenotan; 2-(1-methylpropyl)-4,6-dinitrophenol; Dibutox; EINECS 201-861-7; DNBP; Hivertox; 4,6-Dinitro-o-sec-butylphenol; rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol; 2,4-dinitro-6-sec-butyl phenol; MFCD00024246 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21300 |
| Purity | 98.00 |
| Density | 1.29 |
| Boiling Point | 318.1ºC at 760 mmHg |
| Melting Point | 55.5°C |
| Water Solubility | 0.0052 g/100 mL |
| Storage Condition | This product should be sealed and stored away from |
| Packaging | II |
| HTC | 2908910000 |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |
| InChI Key | OWZPCEFYPSAJFR-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 77101502 |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/17589_1_88_85_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromobenzoic acid | 88-65-3 | 2A-9017579 |
| 2-Iodobenzoic acid | 88-67-5 | 2A-9017580 |
| Anthranilamide | 88-68-6 | 2A-9017581 |
| 2-Isopropylphenol | 88-69-7 | 2A-9017582 |
| 4-Chloro-3-(3-methyl-5-oxo-2-pyrazolin-1-yl)benzenesulfonic acid | 88-76-6 | 2A-9017587 |
| 2,5-Dichloro-3-nitrobenzoic acid | 88-86-8 | 2A-9017590 |
| Picric acid | 88-89-1 | 2A-9017591 |
| 4-Chloro-3,5-dinitrobenzenesulfonic acid | 88-91-5 | 2A-9017592 |
| Phthaloyl dichloride | 88-95-9 | 2A-9017593 |
| Pathalic acid | 88-99-3 | 2A-9017594 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA