
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 117796-52-8 |
| Catalog No. | 2A-3175432 |
| Chinese Name | N-乙酰去氯雷他定 |
| Synonyms | N-Acetyldesloratadine; PegCNTF; RESPATADINE |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.86 |
| Density | 1.257g/cm3 |
| Boiling Point | 546.9ºC at 760mmHg |
| Storage Condition | -20°C |
| Application | N-Acetyldesloratadine (SCH-37370) is a potent, orally active dual antagonist of platelet-activating factor (PAF) and histamine. N-Acetyldesloratadine inhibits PAF-induced human platelet aggregation wi |
| MDL Number | MFCD00873685 |
| SMILES | Clc1cc2c(cc1)C(=C4CCN(CC4)C(=O)C)c3ncccc3CC2 |
| InChI | 1S/C21H21ClN2O/c1-14(25)24-11-8-15(9-12-24)20-19-7-6-18(22)13-17(19)5-4-16-3-2-10-23-21(16)20/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3 |
| InChI Key | FLTBEMVEAFMWDD-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/175858_1_117796_52_8.pdf |
| Transport Info | Product Name: N-Acetyl Desloratadine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-PENTANOYLBENZOIC ACID | 550-37-8 | 2A-3175408 |
| 2-(DiethylaMino)-N-(2,3-diMethylphenyl)acetaMide Hydrochloride | 857170-72-0 | 2A-3175411 |
| Nitrendipine Propyl Ester | 225785-54-6 | 2A-3175425 |
| Nitrendipine Dipropyl Ester | 77888-05-2 | 2A-3175428 |
| 4-CHLORO-1-BUTENE | 927-73-1 | 2A-3175431 |
| Loratadine N-Oxide | 165739-62-8 | 2A-3175437 |
| 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride | 1012864-23-1 | 2A-3175442 |
| lignocaine N-oxide | 2903-45-9 | 2A-3175446 |
| Nor Lidocaine Hydrochloride | 7729-94-4 | 2A-3175452 |
| N-(3,3-diphenylpropyl)-N,2-dimethylprop-2- en-1-amine | 2A-3175456 | 2A-3175456 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA