
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93236-42-1 |
| Catalog No. | 2A-1175241 |
| Chinese Name | 肉苁蓉苷A |
| Synonyms | cistanoside A; I07-0327 |
| Molecular Formula | C36H48O20 |
| Molecular Weight | 800.754 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1058.1±65.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| Application | Cistanoside A is a phenylpropanoid compound in Cistanche deserticola that can reduce the accumulation of NO, but has no effect on the mRNA and protein levels and activity of inducible nitric oxide syn |
| SMILES | COc1cc(CCO[C@@H]2O[C@H](CO[C@@H]3O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](OC(=O)\C=C\c4ccc(O)c(O)c4)[C@H](O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C36H48O20/c1-15-25(42)27(44)30(47)36(52-15)56-33-31(48)35(50-10-9-17-4-7-19(39)21(12-17)49-2)54-23(14-51-34-29(46)28(45)26(43)22(13-37)53-34)32(33)55-24(41)8-5-16-3-6-18(38)20(40)11-16/h3-8,11-12,15,22-23,25-40,42-48H,9-10,13-14H2,1-2H3/b8-5+/t15-,22-,23+,25-,26+,27+,28-,29+,30+,31+,32+,33+,34+,35+,36-/m0/s1 |
| InChI Key | InChIKey=LOGNFAUMIGACHZ-SCWCVTEDSA-N |
| MSDS | msds/175662_1_93236_42_1.pdf |
| Transport Info | Product name: Cistanche deserticola glycoside A |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| IODOMETHANE-D3 | 865-50-9 | 2A-1175232 |
| phenazine-1-carboxamide | 550-89-0 | 2A-1175234 |
| PERFLUOROPOLYALKYL ETHER | 60164-51-4 | 2A-1175236 |
| METHYL PERFLUOROBUTYL ETHER | 163702-08-7 | 2A-1175237 |
| methyl 2,2,3,3-tetrafluoro-3-methoxypropionate | 755-73-7 | 2A-1175238 |
| TRIBULOSIDE | 22153-44-2 | 2A-1175243 |
| 3,3'-[Oxybis(2,1-ethanediyloxy)]bispropanenitrile | 22397-31-5 | 2A-1175244 |
| Aurone | 57060-61-4 | 2A-1175245 |
| Aurone | 38216-53-4 | 2A-1175246 |
| DRACORHODIN PEROCHLORATE | 125536-25-6 | 2A-1175247 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA