
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1657014-33-9 |
| Catalog No. | 2A-3175198 |
| Chinese Name | 非布司他杂质 11 |
| Synonyms | 2-(4-Butoxy-3-cyanophenyl)-4-methyl-5-thiazolecarboxylic acid |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.37 |
| Density | 1.31±0.1 g/cm3 (20 ºC 760 Torr) |
| Water Solubility | Insuluble (2.6E-3 g/L) (25 ºC) |
| Storage Condition | room temperature |
| Application | Febuxostat n-butyl isomer is an impurity of Febuxostat. Febuxostat is a selective xanthine oxidase (XO) inhibitor with a Ki of 0.6 nM. |
| SMILES | CCCCOc1ccc(-c2nc(C)c(C(=O)O)s2)cc1C#N |
| InChI Key | KFYGOMDVRIXGBJ-UHFFFAOYSA-N |
| MSDS | msds/175617_1_1657014_33_9.pdf |
| Transport Info | Product name: 2-(4-Butoxy-3-cyanophenyl)-4-methylthiazole-5-carboxylic acid |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(3-Chloropropyl)piperidine HCl | 1458-63-5 | 2A-2175190 |
| 3-Iodo-1H-pyrazole-4-carbonitrile | 827316-44-9 | 2A-2175191 |
| 2-(4-(tert-butoxy)-3-cyanophenyl)-4- methylthiazole-5-carboxylic acid | 2A-3175195 | 2A-3175195 |
| 2-(4-isobutoxy-3-(methoxycarbonyl)phenyl)- 4-methylthiazole-5-carboxylic acid | 2A-3175196 | 2A-3175196 |
| (E)-ethyl 2-(4-hydroxy-3- ((hydroxyimino)methyl)phenyl)-4- methylthiazole-5-carboxylate | 2A-3175197 | 2A-3175197 |
| 5-(3-cyano-4-propoxyphenyl)-3- methylthiophene-2-carboxylic acid | 1530308-87-2 | 2A-3175199 |
| (E)-ethyl 2-(3-((hydroxyimino)methyl)-4- isobutoxyphenyl)-4-methylthiazole-5- carboxylate | 1271738-74-9 | 2A-3175200 |
| ethyl 2-(3-cyano-4-propoxyphenyl)-4- methylthiazole-5-carboxylate | 2A-3175203 | 2A-3175203 |
| ethyl 2-(4-(tert-butoxy)-3-cyanophenyl)-4- methylthiazole-5-carboxylate | 2A-3175204 | 2A-3175204 |
| ethyl 2-(4-(sec-butoxy)-3-cyanophenyl)-4- methylthiazole-5-carboxylate | 2A-3175205 | 2A-3175205 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA