
CAS Number2047-89-4
Synonymstetrahydro-2,3,4,5-indolo-2,3b-1H-cycloheptatriene; Cycloheptano<2,3-cycloheptenoindole; 5,6,7,8,9,10-HEXAHYDROCYCLOHEPTA[B]INDOLE; 5,6,7,8,9,10-HEXAHYDROCYCLOHEPT[B]INDOLE; cyclohepteno<indole; MFCD00101340; 1,2,3,4,5,6-Hexahydrocyclohept<b>indol
Molecular FormulaC13H15N
Molecular Weight185.26500
Density1.113g/cm3
Boiling Point340.4ºC at 760mmHg
Melting Point140-142ºC
Appearancecrystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2047-89-4 |
| Catalog No. | 2A-1174805 |
| Chinese Name | 吲哚(2,3-b)环庚烯 |
| Synonyms | tetrahydro-2,3,4,5-indolo-2,3b-1H-cycloheptatriene; Cycloheptano<2,3-cycloheptenoindole; 5,6,7,8,9,10-HEXAHYDROCYCLOHEPTA[B]INDOLE; 5,6,7,8,9,10-HEXAHYDROCYCLOHEPT[B]INDOLE; cyclohepteno<indole; MFCD00101340; 1,2,3,4,5,6-Hexahydrocyclohept<b>indol |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.26500 |
| Density | 1.113g/cm3 |
| Boiling Point | 340.4ºC at 760mmHg |
| Melting Point | 140-142ºC |
| Appearance | crystalline powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933990090 |
| PubChem ID | 115461 |
| SMILES | c1ccc2c3c([nH]c2c1)CCCCC3 |
| InChI | InChI=1S/C13H15N/c1-2-6-10-11-7-4-5-9-13(11)14-12(10)8-3-1/h4-5,7,9,14H,1-3,6,8H2 |
| InChI Key | XZUJMYLNFZHNLP-UHFFFAOYSA-N |
| MSDS | msds/175175_1_2047_89_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1-Methyl-1H-pyrazol-3-yl)benzoic acid methyl ester | 179057-11-5 | 2A-1174789 |
| 9-bromine-11,11-dimethyl-11H-benzo[a]fluorene | 1198396-29-0 | 2A-1174795 |
| 4-bromo-4'-(pentyloxy)-1,1'-biphenyl | 63619-51-2 | 2A-1174800 |
| Methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate | 1142224-62-1 | 2A-1174803 |
| Methyl3-(4-hydroxyphenyl)hex-4-ynoate | 865234-02-2 | 2A-1174804 |
| (2,6-Diethylphenyl)hydrazine hydrochloride | 132370-95-7 | 2A-1174806 |
| methyl 2,5-dichloroisonicotinate | 623585-74-0 | 2A-1174807 |
| 4-amino-5,6-dimethyl thieno(2,3-d)pyrimidin-2(1H)-one hydrochloride | 1033366-59-4 | 2A-1174808 |
| R-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol | 75684-93-4 | 2A-1174809 |
| S-3,3'-Bis(phenyl)-1,1'-bi-2-naphthol | 102490-05-1 | 2A-1174810 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA