
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70290-55-0 |
| Catalog No. | 2A-2174761 |
| Chinese Name | Methyl (2Z)-3-ethoxy-2-nitroacrylate |
| Synonyms | METHYL 3-ETHOXY-2-NITROPROPENOATE; Methyl 3-ethoxy-2-nitroacrylate; Methyl (2Z)-3-ethoxy-2-nitroacrylate |
| Molecular Formula | C10H19O5N3 |
| Molecular Weight | 261.28 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 264.0±35.0 °C at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 42670439 |
| MDL Number | MFCD30723268 |
| SMILES | CCOC=C(C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C6H9NO5/c1-3-12-4-5(7(9)10)6(8)11-2/h4H,3H2,1-2H3/b5-4+ |
| InChI Key | CLVDISHFCPMLTI-SNAWJCMRSA-N |
| MSDS | msds/175131_1_70290_55_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-(N,N,N-trimethylammonio)hexyl bromide | 191086-27-8 | 2A-1174739 |
| Octyl(tributyl)phosphonium chloride | 56315-19-6 | 2A-1174740 |
| ETHYL 10-BROMODECANOATE | 55099-31-5 | 2A-1174741 |
| 4-CHLOROBUTYRIC ACID | 627-00-9 | 2A-1174742 |
| 1-(2-Chloro-5-fluoropyridin-3-yl)ethanone | 1203499-12-0 | 2A-1174752 |
| 1,8-Naphthyridin-4(1H)-one,2,3-dihydro-(9CI) | 676515-33-6 | 2A-2174762 |
| 3-(METHYLTHIO) BENZOIC ACID | 875-99-0 | 2A-3174764 |
| 2-IODOTHIOANISOLE | 3375-94-9 | 2A-3174765 |
| 4-Ethylcyano-2-chlorothioansole | 2A-3174766 | 2A-3174766 |
| 2-Fluoro-4-methylthio benzoic acid | 2A-1174767 | 2A-1174767 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA